CAS 1965310-22-8: 1H-1,4-Diazepine, hexahydro-6,6-dimethyl-, hydrochloride (1:2)

Description:1H-1,4-Diazepine, hexahydro-6,6-dimethyl-, hydrochloride (1:2) is a chemical compound characterized by its bicyclic structure, which includes a diazepine ring. This compound features a saturated six-membered ring with two nitrogen atoms at the 1 and 4 positions, contributing to its classification as a diazepine. The presence of two methyl groups at the 6 position enhances its steric properties and may influence its biological activity. As a hydrochloride salt, it is typically more soluble in water, which can facilitate its use in various applications, including pharmaceuticals. The compound may exhibit psychoactive properties, similar to other diazepines, and could be investigated for its potential therapeutic effects. Its molecular structure and functional groups suggest it may interact with neurotransmitter systems, although specific biological activities would require further empirical study. Safety data and handling precautions should be observed, as with all chemical substances, particularly those with psychoactive potential.

Formula:C₇H₁₆N₂·2ClH

InChI:InChI=1S/C7H16N2.2ClH/c1-7(2)5-8-3-4-9-6-7;;/h8-9H,3-6H2,1-2H3;2*1H

InChI key:InChIKey=NGEMISSGSRHNML-UHFFFAOYSA-N

SMILES:Cl.N1CCNCC(C)(C)C1