CAS 19658-77-6

1-iodoisoquinoline

Description:

1-Iodoisoquinoline is an organic compound characterized by the presence of an iodine atom attached to the isoquinoline structure, which is a bicyclic compound derived from quinoline. It features a nitrogen atom within the aromatic ring system, contributing to its unique chemical properties. The presence of the iodine substituent enhances its reactivity, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. This compound is typically a pale yellow to brown solid and is sparingly soluble in water but more soluble in organic solvents. Its molecular structure allows for potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as well as in organic synthesis. Additionally, 1-iodoisoquinoline can serve as a precursor for the synthesis of other complex molecules, highlighting its significance in both academic research and industrial applications. Safety precautions should be taken when handling this compound, as iodine can be hazardous, and proper storage conditions are essential to maintain its stability.

Formula: C₉H₆IN

InChI: InChI=1/C9H6IN/c10-9-8-4-2-1-3-7(8)5-6-11-9/h1-6H

SMILES: c1ccc2c(c1)ccnc2I

Synonyms:

• Isoquinoline, 1-Iodo-

1-Iodoisoquinoline

CAS: 19658-77-6

Formula: C₉H₆IN

Purity: 98%

Color and Shape: Solid

Molecular weight: 255.0551

Ref: IN-DA00ACU9

1-Iodoisoquinoline

CAS: 19658-77-6

1-Iodoisoquinoline

Purity: 98%

Molecular weight: 255.06g/mol

Ref: 54-OR91120

1-Iodoisoquinoline

CAS: 19658-77-6

Formula: C₉H₆IN

Purity: >98.0%(GC)(T)

Color and Shape: Light yellow to Yellow to Green powder to crystal

Molecular weight: 255.06

Ref: 3B-I0750

1-IODOISOQUINOLINE

CAS: 19658-77-6

Formula: C₉H₆IN

Purity: 98%

Color and Shape: Solid

Molecular weight: 255.058

Ref: 10-F303168