![N-[2-[(8R)-1,6,7,8-Tetrahydro-2H-indeno[5,4-b]furan-8-yl]ethyl]propanamide](/_next/image/?url=https%3A%2Fstatic.cymitquimica.com%2Fcas-image%2Fthumb-webp%2F34919-n-2-8r-1678-tetrahydro-2h-indeno-54-b-furan-8-yl-ethyl-propanamide.webp&w=3840&q=75)
CAS 196597-27-0
:N-[2-[(8R)-1,6,7,8-Tetrahydro-2H-indeno[5,4-b]furan-8-yl]ethyl]propanamide
Description:
N-[2-[(8R)-1,6,7,8-Tetrahydro-2H-indeno[5,4-b]furan-8-yl]ethyl]propanamide, with the CAS number 196597-27-0, is a chemical compound characterized by its complex structure, which includes a tetrahydroindeno-furan moiety. This compound features an amide functional group, which is indicative of its potential biological activity, particularly in medicinal chemistry. The presence of the indeno-furan structure suggests that it may exhibit unique pharmacological properties, possibly influencing its interaction with biological targets. The stereochemistry, denoted by the (8R) configuration, indicates that the compound has specific spatial arrangements that can significantly affect its reactivity and biological activity. Additionally, the ethyl and propanamide substituents contribute to its solubility and stability in various environments. Overall, this compound's unique structural features may make it of interest in drug development and research, particularly in areas related to neuropharmacology or other therapeutic applications.
Formula:C16H21NO2
InChI:InChI=1S/C16H21NO2/c1-2-15(18)17-9-7-12-4-3-11-5-6-14-13(16(11)12)8-10-19-14/h5-6,12H,2-4,7-10H2,1H3,(H,17,18)/t12-/m1/s1
InChI key:InChIKey=YLXDSYKOBKBWJQ-GFCCVEGCSA-N
SMILES:C(CNC(CC)=O)[C@@H]1C=2C3=C(C=CC2CC1)OCC3
Synonyms:- Propanamide, N-[2-[(8R)-1,6,7,8-tetrahydro-2H-indeno[5,4-b]furan-8-yl]ethyl]-
- N-[2-[(8R)-1,6,7,8-Tetrahydro-2H-indeno[5,4-b]furan-8-yl]ethyl]propanamide
- Propanamide, N-[2-(1,6,7,8-tetrahydro-2H-indeno[5,4-b]furan-8-yl)ethyl]-, (R)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
