CymitQuimica logo

CAS 196597-80-5

:

2-[(8S)-1,6,7,8-Tetrahydro-2H-indeno[5,4-b]furan-8-yl]ethanamine hydrochloride (1:1)

Description:
2-[(8S)-1,6,7,8-Tetrahydro-2H-indeno[5,4-b]furan-8-yl]ethanamine hydrochloride is a chemical compound characterized by its complex bicyclic structure, which includes a tetrahydroindeno-furan moiety. This compound features an amine functional group, contributing to its potential biological activity. The hydrochloride salt form indicates that it is a protonated amine, enhancing its solubility in water and making it suitable for various applications, particularly in pharmaceutical contexts. The stereochemistry of the compound is significant, as the (8S) configuration suggests specific spatial arrangements that can influence its interaction with biological targets. This compound may exhibit properties such as neuroactivity or other pharmacological effects, although specific biological activities would depend on further empirical studies. Its CAS number, 196597-80-5, allows for precise identification in chemical databases, facilitating research and development in medicinal chemistry and related fields. Overall, this compound represents a unique structure with potential implications in drug discovery and development.
Formula:C13H18ClNO
InChI:InChI=1S/C13H17NO.ClH/c14-7-5-10-2-1-9-3-4-12-11(13(9)10)6-8-15-12;/h3-4,10H,1-2,5-8,14H2;1H/t10-;/m0./s1
InChI key:PTRBVFJPGFTDDU-PPHPATTJSA-N
SMILES:C1C[C@@H](CCN)c2c1ccc1c2CCO1.Cl
Synonyms:
  • (S)-2-(1,6,7,8-Tetrahydro-2H-indeno[5,4-b]furan-8-yl)ethylamine hydrochloride
Found 5 products.