CAS 1966-58-1
:Dichlormate
Description:
Dichlormate, with the CAS number 1966-58-1, is a chemical compound that is primarily recognized as a chlorinated derivative of a nitrate. It is characterized by its molecular structure, which includes chlorine and oxygen atoms, contributing to its reactivity and potential applications in various chemical processes. Dichlormate is typically a yellowish or greenish solid that can be sensitive to heat and shock, making it important to handle with care. It is known for its oxidizing properties, which can facilitate combustion reactions and may pose risks in terms of stability and safety. In terms of solubility, dichlormate is generally soluble in polar solvents, which can influence its behavior in different chemical environments. Due to its reactive nature, it is often used in specialized applications, including organic synthesis and as a reagent in analytical chemistry. Proper storage and handling protocols are essential to mitigate any hazards associated with its use.
Formula:C9H9Cl2NO2
InChI:InChI=1S/C9H9Cl2NO2/c1-12-9(13)14-5-6-2-3-7(10)8(11)4-6/h2-4H,5H2,1H3,(H,12,13)
InChI key:InChIKey=DSVOTYIOPGIVPP-UHFFFAOYSA-N
SMILES:C(OC(NC)=O)C1=CC(Cl)=C(Cl)C=C1
Synonyms:- (3,4-Dichlorophenyl)methyl N-methylcarbamate
- 3,4-Dichlorobenzyl Methylcarbamate
- 3,4-Sirmate
- Benzenemethanol, 3,4-dichloro-, 1-(N-methylcarbamate)
- Benzenemethanol, 3,4-dichloro-, methylcarbamate
- Carbamic acid, methyl-, 3,4-dichlorobenzyl ester
- N-Methylcarbamic acid 3,4-dichlorobenzyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
