CAS 19674-60-3

3,6-dimethyl-1h-pyrimidine-2,4-dione

Description:

3,6-Dimethyl-1H-pyrimidine-2,4-dione, with the CAS number 19674-60-3, is an organic compound belonging to the pyrimidine family, characterized by a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. This compound features two methyl groups attached at the 3 and 6 positions, contributing to its structural diversity and potential reactivity. The presence of two carbonyl groups at positions 2 and 4 gives it the dione classification, which is significant for its chemical behavior, particularly in forming hydrogen bonds and participating in various chemical reactions. It is typically a crystalline solid and may exhibit solubility in polar solvents due to its functional groups. The compound is of interest in medicinal chemistry and organic synthesis, as derivatives of pyrimidine are often found in pharmaceuticals and agrochemicals. Its properties, such as melting point, boiling point, and reactivity, can vary based on environmental conditions and the presence of other functional groups in a given reaction context.

Formula: C₆H₈N₂O₂

InChI: InChI=1/C6H8N2O2/c1-4-3-5(9)8(2)6(10)7-4/h3H,1-2H3,(H,7,10)

SMILES: Cc1cc(=O)n(C)c(n1)O

Synonyms:

• 2,4(1H,3H)-Pyrimidinedione, 3,6-dimethyl-
• 3,6-dimethylpyrimidine-2,4(1H,3H)-dione

3,6-Dimethylpyrimidine-2,4(1H,3H)-dione

CAS: 19674-60-3

Formula: C₆H₈N₂O₂

Molecular weight: 140.1399

Ref: IN-DA007R3T

3,6-Dimethylpyrimidine-2,4(1H,3H)-dione

CAS: 19674-60-3

3,6-Dimethylpyrimidine-2,4(1H,3H)-dione is a chemical compound that has been found to be active against influenza virus. It is an acidic compound that binds to positively charged amino acids on the viral envelope and inhibits viral fusion with host cells. The linker group in 3,6-dimethylpyrimidine-2,4(1H,3H)-dione is the same as that of dimethylsulfate, which is a chemical compound used for the synthesis of other compounds. X-ray diffraction data for this compound have been obtained at high resolution and show it to be a chloride salt. The chloride ion may be important in the antiviral activity of 3,6-dimethylpyrimidine-2,4(1H,3H)-dione because it can react with radicals formed during influenza replication. This compound also has antiradical activities against Coxsackievirus B3 (

Formula: C₆H₈N₂O₂

Purity: Min. 95%

Molecular weight: 140.14 g/mol

Ref: 3D-FD130769

3,6-Dimethyl-1H-pyrimidine-2,4-dione

CAS: 19674-60-3

Formula: C₆H₈N₂O₂

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 140.142

Ref: 10-F015805