CymitQuimica logo

CAS 19676-64-3

:

2,3,4-Trimethoxyphenol

Description:
2,3,4-Trimethoxyphenol, with the CAS number 19676-64-3, is an organic compound characterized by the presence of three methoxy (-OCH3) groups attached to a phenolic ring. This compound typically appears as a white to off-white solid and is soluble in organic solvents, reflecting its hydrophobic nature due to the methoxy substituents. The presence of the hydroxyl group (-OH) in the phenol structure imparts some degree of polarity, allowing for potential interactions with polar solvents. 2,3,4-Trimethoxyphenol is known for its antioxidant properties and may exhibit biological activity, making it of interest in various fields, including pharmaceuticals and natural product chemistry. Its chemical structure allows for potential applications in the synthesis of more complex organic molecules. Additionally, the compound's stability and reactivity can be influenced by the positioning of the methoxy groups, which can affect its electronic properties and reactivity in chemical reactions. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C9H12O4
InChI:InChI=1/C9H12O4/c1-11-7-5-4-6(10)8(12-2)9(7)13-3/h4-5,10H,1-3H3
InChI key:OLUNIGWWQYXBJA-UHFFFAOYSA-N
SMILES:COc1ccc(c(c1OC)OC)O
Synonyms:
  • 2,3,4-Trimethoxybenzolol
  • Phenol, 2,3,4-trimethoxy-
Found 4 products.