CAS 19686-73-8
:1-bromopropan-2-ol
Description:
1-Bromopropan-2-ol, with the CAS number 19686-73-8, is an organic compound characterized by the presence of a bromine atom and a hydroxyl group (-OH) attached to a three-carbon alkane chain. It is classified as a secondary alcohol due to the positioning of the hydroxyl group on the second carbon of the propyl chain. This compound typically appears as a colorless to pale yellow liquid and is soluble in water due to the polar nature of the hydroxyl group. Its molecular structure contributes to its reactivity, allowing it to participate in various chemical reactions, such as nucleophilic substitutions and eliminations. 1-Bromopropan-2-ol can be used as an intermediate in organic synthesis, particularly in the preparation of other brominated compounds or alcohols. Additionally, it may exhibit moderate toxicity, necessitating appropriate safety precautions during handling and use. Overall, its unique functional groups and structural characteristics make it a valuable compound in chemical research and industrial applications.
Formula:C3H7BrO
InChI:InChI=1/C3H7BrO/c1-3(5)2-4/h3,5H,2H2,1H3/t3-/m0/s1
InChI key:InChIKey=WEGOLYBUWCMMMY-UHFFFAOYSA-N
SMILES:C(CBr)(C)O
Synonyms:- (2R)-1-bromopropan-2-ol
- (2S)-1-bromopropan-2-ol
- 1-Bromo-2-hydroxypropane
- 1-Bromo-2-propanol
- 2-Hydroxy-2-methylethyl bromide
- 2-Hydroxypropyl bromide
- 2-Propanol, 1-bromo-
- Brn 1071195
- Ccris 5978
- Propylene bromohydrin
- 1-Bromopropan-2-ol
- 1-BROMOPROPANOL-2
- 1-Bromo-2-propanol (contains ca. 20% 2-Bromo-1-propanol) (stabilized with MgO)
- 2-hydroxypropylbromide
- 1-bromo-2-propano
- 1-Bromo-2-propanol, remainder 2-bromo-1-propanol, tech., 70%
- 1-BROMO-2-PROPANOL, TECH., 70%
- 1-Bromo-2-propanol, pract., 75%
- 1-Bromo-2-propanol, 70%, remainder 2-bromo-1-propanol, tech.
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1-Bromo-2-propanol (contains ca. 20% 2-Bromo-1-propanol) (stabilized with MgO)
CAS:Formula:C3H7BrOPurity:>75.0%(GC)Color and Shape:Colorless to Light yellow clear liquidMolecular weight:138.991-Bromo-2-propanol
CAS:1-Bromo-2-propanolFormula:C3H7BrOPurity:75%,stabilized with MgOColor and Shape: colourless liquidMolecular weight:138.99g/mol1-Bromo-2-propanol
CAS:Silver trifluoromethanesulfonate is a chemical that is used in the manufacture of 1-bromo-2-propanol. When it reacts with hydroxyl groups, it forms an anhydrous sodium salt that can be used to inhibit population growth. Silver trifluoromethanesulfonate has been shown to have an inhibitory effect on human serum and postharvest populations of bacteria by reacting with the hydroxyl group in the enzyme population growth. Chemical ionization mass spectrometry (CI-MS) has been used to identify the aromatic hydrocarbon produced during this reaction. The mechanism for this reaction is thought to be due to hydrogen bonding between silver trifluoromethanesulfonate and the hydroxyl group.
Formula:C3H7BrOPurity:Min. 95%Molecular weight:138.99 g/mol




