CymitQuimica logo

CAS 19687-04-8

:

2-(1-methylcyclopropyl)ethanol

Description:
2-(1-Methylcyclopropyl)ethanol is an organic compound characterized by its unique structure, which includes a cyclopropyl group attached to a two-carbon ethanol backbone. This compound features a hydroxyl (-OH) functional group, which classifies it as an alcohol. The presence of the methylcyclopropyl group contributes to its distinct physical and chemical properties, such as its boiling point, solubility, and reactivity. Typically, alcohols like this one exhibit moderate polarity due to the hydroxyl group, allowing for hydrogen bonding, which influences their solubility in water and other polar solvents. The compound may also participate in various chemical reactions, including oxidation and esterification. Its specific applications can vary, but it may be utilized in organic synthesis or as an intermediate in the production of more complex molecules. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C6H12O
InChI:InChI=1/C6H12O/c1-6(2-3-6)4-5-7/h7H,2-5H2,1H3
InChI key:FDVDMIVJLUCMSF-UHFFFAOYSA-N
SMILES:CC1(CC1)CCO
Found 4 products.