CAS 196934-77-7

4-[(3-chloro-2-methylphenyl)amino]-4-oxobutanoic acid

Description:

4-[(3-Chloro-2-methylphenyl)amino]-4-oxobutanoic acid, identified by its CAS number 196934-77-7, is an organic compound characterized by its unique structure that includes an amino group, a chloro-substituted aromatic ring, and a keto acid functional group. This compound typically exhibits properties associated with both amines and carboxylic acids, such as potential solubility in polar solvents and the ability to participate in hydrogen bonding. The presence of the chloro and methyl groups on the aromatic ring can influence its reactivity and biological activity, potentially affecting its interactions in various chemical environments. Additionally, the keto group contributes to its acidity, making it a candidate for various chemical reactions, including condensation and substitution reactions. The compound may also exhibit specific pharmacological properties, making it of interest in medicinal chemistry. However, detailed studies would be necessary to fully elucidate its behavior in biological systems and its potential applications in pharmaceuticals or other fields.

Formula: C₁₁H₁₂ClNO₃

InChI: InChI=1/C11H12ClNO3/c1-7-8(12)3-2-4-9(7)13-10(14)5-6-11(15)16/h2-4H,5-6H2,1H3,(H,13,14)(H,15,16)

SMILES: Cc1c(cccc1N=C(CCC(=O)O)O)Cl

Synonyms:

• Butanoic Acid, 4-[(3-Chloro-2-Methylphenyl)Amino]-4-Oxo-
• CHEMBRDG-BB 4024600
• 4-[(3-chloro-2-methylphenyl)amino]-4-oxobutanoic acid(SALTDATA: FREE)
• 4-[(3-CHLORO-2-METHYLPHENYL)AMINO]-4-OXOBUTANOIC ACID
• ASISCHEM D13244
• OTAVA-BB 7020401180

4-[(3-chloro-2-methylphenyl)amino]-4-oxobutanoic acid

CAS: 196934-77-7

Formula: C₁₁H₁₂ClNO₃

Purity: 95.0%

Molecular weight: 241.67

Ref: 10-F310140