CAS 196936-04-6

Polyethylene glycol 2-aminoethyl 2-carboxyethyl ether

Description:

Polyethylene glycol 2-aminoethyl 2-carboxyethyl ether, identified by its CAS number 196936-04-6, is a synthetic polymer that exhibits both hydrophilic and hydrophobic characteristics due to its polyethylene glycol (PEG) backbone and functional groups. This compound typically features a flexible structure, which enhances its solubility in water and various organic solvents. The presence of amino and carboxyl groups allows for potential interactions with biological systems, making it useful in pharmaceutical and biomedical applications, such as drug delivery and tissue engineering. Its biocompatibility and non-toxicity further contribute to its appeal in these fields. Additionally, the molecular weight and degree of polymerization can influence its physical properties, such as viscosity and melting point. Overall, this compound is valued for its versatility and functionality in various chemical and biological applications.

Formula: (C₂H₄O)nC₅H₁₁NO₃

InChI: InChI=1S/C7H15NO4/c8-2-4-12-6-5-11-3-1-7(9)10/h1-6,8H2,(H,9,10)

InChI key: InChIKey=DEZXLFKSYRODPB-UHFFFAOYSA-N

SMILES: O(CCOCCN)CCC(O)=O

Synonyms:

• NH2-PEG10-COOH
• Thermo Scientific Carboxy-PEG-Amine
• Poly(oxy-1,2-ethanediyl), α-(2-aminoethyl)-ω-(2-carboxyethoxy)-
• O-(2-Aminoethyl)-O′-(2-carboxyethyl)polyethylene glycol
• Polyethylene glycol 2-aminoethyl 2-carboxyethyl ether

Amino-(PEG)n-Acid

CAS: 196936-04-6

Formula: C₅₃H₁₀₇NO₂₇

Purity: 97%

Color and Shape: Solid

Molecular weight: 1190.4072

Ref: IN-DA00234P

Amino-(PEG)n-acid (PEG24)

CAS: 196936-04-6

Amino-(PEG)n-acid

Formula: (C₂H₄O)nC₅H₁₁NO₃

Purity: PEG24

Ref: IN-DG01636766

H2N-PEG12-CH2CH2COOH

CAS: 196936-04-6

H2N-PEG12-CH2CH2COOH is a PEG compound with two different functional groups (also known as heterobifunctional). Unlike homobifunctional PEG compounds (same functional group on both ends), this type of compounds are more versatile as have two different anchor points. H2N-PEG12-CH2CH2COOH is used as a linker and spacer to add a PEG moiety, via pegylation (a bioconjugation technique) to proteins, peptides, oligonucleotides, small molecules and nanoparticles.

Formula: C₂₇H₅₅NO₁₄

Purity: Min. 95%

Color and Shape: White Powder

Molecular weight: 617.72 g/mol

Ref: 3D-FP73011