CymitQuimica logo

CAS 19694-02-1

:

pyrene-1-carboxylic acid

Description:
Pyrene-1-carboxylic acid is an aromatic compound characterized by its polycyclic structure, which includes a pyrene moiety with a carboxylic acid functional group at the first position. This compound typically appears as a white to pale yellow solid and is known for its relatively high melting point. Pyrene-1-carboxylic acid is soluble in organic solvents such as ethanol and acetone but has limited solubility in water due to its hydrophobic pyrene structure. It exhibits fluorescence properties, making it useful in various applications, including fluorescence spectroscopy and as a fluorescent probe in biochemical studies. The presence of the carboxylic acid group allows for potential reactivity, enabling it to participate in various chemical reactions, such as esterification and amidation. Additionally, pyrene derivatives are often studied for their potential applications in materials science, organic electronics, and as intermediates in organic synthesis. Overall, pyrene-1-carboxylic acid is a versatile compound with significant relevance in both research and industrial applications.
Formula:C17H10O2
InChI:InChI=1/C17H10O2/c18-17(19)14-9-7-12-5-4-10-2-1-3-11-6-8-13(14)16(12)15(10)11/h1-9H,(H,18,19)
InChI key:HYISVWRHTUCNCS-UHFFFAOYSA-N
SMILES:c1cc2ccc3ccc(c4ccc(c1)c2c34)C(=O)O
Synonyms:
  • 1-Pyrenecarboxylic acid
Found 6 products.