CAS 1970-81-6

3,3'-Bipyridine-5-carboxylic acid

Description:

3,3'-Bipyridine-5-carboxylic acid is an organic compound characterized by its bipyridine structure, which consists of two pyridine rings connected by a carbon chain. This compound features a carboxylic acid functional group (-COOH) at the 5-position of one of the pyridine rings, contributing to its acidic properties. It is typically a white to off-white crystalline solid that is soluble in polar solvents such as water and alcohols, owing to the presence of the carboxylic acid group. The compound exhibits potential applications in coordination chemistry, as it can act as a ligand for metal ions, forming various metal complexes. Additionally, it may serve as an intermediate in the synthesis of pharmaceuticals and agrochemicals. The presence of both nitrogen atoms in the pyridine rings allows for interesting electronic properties, making it a subject of study in materials science and organic synthesis. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₁₁H₈N₂O₂

InChI: InChI=1/C11H8N2O2/c14-11(15)10-4-9(6-13-7-10)8-2-1-3-12-5-8/h1-7H,(H,14,15)

SMILES: c1cc(cnc1)c1cc(cnc1)C(=O)O

Synonyms:

• [3,3'-bipyridine]-5-carboxylic acid

3,3'-Bipyridine-5-carboxylic acid

CAS: 1970-81-6

Formula: C₁₁H₈N₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 200.1934

Ref: IN-DA00ALYW

[3,3'-Bipyridine]-5-carboxylic acid

CAS: 1970-81-6

[3,3'-Bipyridine]-5-carboxylic acid

Purity: 97%

Molecular weight: 200.2g/mol

Ref: 54-OR1057777

[3,3'-Bipyridine]-5-carboxylic acid

CAS: 1970-81-6

Versatile small molecule scaffold

Formula: C₁₁H₈N₂O₂

Purity: Min. 95%

Molecular weight: 200.19 g/mol

Ref: 3D-BAA97081