CAS 197005-22-4
:[(2S,3R,4S,6S)-3,5-diacetoxy-4-allyloxy-6-phenylsulfanyl-tetrahydropyran-2-yl]methyl acetate
Description:
The chemical substance with the name "[(2S,3R,4S,6S)-3,5-diacetoxy-4-allyloxy-6-phenylsulfanyl-tetrahydropyran-2-yl]methyl acetate" and CAS number 197005-22-4 is a complex organic compound characterized by its tetrahydropyran ring structure, which is a six-membered cyclic ether. This compound features multiple functional groups, including acetoxy groups, an allyloxy group, and a phenylsulfanyl moiety, contributing to its reactivity and potential applications in organic synthesis. The stereochemistry indicated by the (2S,3R,4S,6S) configuration suggests specific spatial arrangements of its substituents, which can influence its biological activity and interactions. The presence of the acetoxy groups may enhance solubility and reactivity, while the phenylsulfanyl group can provide unique properties, such as increased lipophilicity or potential for further chemical modifications. Overall, this compound's intricate structure and functional diversity make it of interest in fields such as medicinal chemistry and synthetic organic chemistry, where it may serve as a precursor or intermediate in the synthesis of more complex molecules.
Formula:C21H26O8S
InChI:InChI=1/C21H26O8S/c1-5-11-25-19-18(27-14(3)23)17(12-26-13(2)22)29-21(20(19)28-15(4)24)30-16-9-7-6-8-10-16/h5-10,17-21H,1,11-12H2,2-4H3/t17-,18+,19-,20?,21-/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Phenyl 2,4,6-Tri-O-acetyl-3-O-allyl-1-thio-β-D-glucopyranoside
CAS:Formula:C21H26O8SPurity:>98.0%(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:438.49Phenyl 2,4,6-Tri-O-acetyl-3-O-allyl-1-thio-β-D-glucopyranoside
CAS:Formula:C21H26O8SPurity:98.0%Molecular weight:438.4913Phenyl 2,4,6-Tri-O-acetyl-3-O-allyl-b-D-thioglucopyranoside
CAS:<p>Phenyl 2,4,6-tri-O-acetyl-3-O-allyl-β-D-thioglucopyranoside is an enantiomer that can be synthesized from the commercially available 2,4,6-triacetylphenyl boronic acid. It has been shown to have a positive effect on insulin sensitivity and uptake in plasma glucose in diabetic patients. Phenyl 2,4,6-tri-O-acetyl-3-O-allyl β D thioglucopyranoside also has a safety profile that is similar to other antidiabetic drugs. This drug has been shown to inhibit influenza virus uptake into cells by competitive inhibition of a transporter type.</p>Formula:C21H26O8SPurity:Min. 98 Area-%Color and Shape:White Off-White PowderMolecular weight:438.49 g/mol



