CAS 197007-87-7

(4-Bromopyridin-3-yl)methanol

Description:

(4-Bromopyridin-3-yl)methanol is an organic compound characterized by the presence of a brominated pyridine ring and a hydroxymethyl group. Its molecular structure features a pyridine ring substituted at the 3-position with a hydroxymethyl group and at the 4-position with a bromine atom. This compound is typically a colorless to light yellow liquid or solid, depending on its form and purity. It is soluble in polar solvents such as water and alcohols, which is attributed to the hydroxymethyl group that can engage in hydrogen bonding. The presence of the bromine atom enhances its reactivity, making it a useful intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Additionally, (4-Bromopyridin-3-yl)methanol may exhibit biological activity, which can be explored in medicinal chemistry. Safety data should be consulted for handling, as brominated compounds can pose health risks. Overall, this compound serves as a valuable building block in various chemical applications.

Formula: C₆H₆BrNO

InChI: InChI=1/C6H6BrNO/c7-6-1-2-8-3-5(6)4-9/h1-3,9H,4H2

SMILES: c1cncc(CO)c1Br

Synonyms:

• 197007-87-7

(4-Bromopyridin-3-yl)methanol

CAS: 197007-87-7

Formula: C₆H₆BrNO

Purity: 98%

Color and Shape: Solid

Molecular weight: 188.0219

Ref: IN-DA00AQ6A

(4-Bromopyridin-3-yl)methanol

CAS: 197007-87-7

(4-Bromopyridin-3-yl)methanol

Purity: 97%

Color and Shape: Solid

Molecular weight: 188.02g/mol

Ref: 54-OR959659

(4-Bromopyridin-3-yl)methanol

CAS: 197007-87-7

Formula: C₆H₆BrNO

Purity: 95%

Color and Shape: Solid

Molecular weight: 188.024

Ref: 10-F210034