CAS 19715-19-6
:3,5-Bis(1,1-dimethylethyl)-2-hydroxybenzoic acid
Description:
3,5-Bis(1,1-dimethylethyl)-2-hydroxybenzoic acid, commonly known as a derivative of salicylic acid, is characterized by its unique structure that includes two tert-butyl groups at the 3 and 5 positions and a hydroxyl group at the 2 position of the benzene ring. This compound is typically a white to off-white crystalline solid, exhibiting moderate solubility in organic solvents and limited solubility in water due to its hydrophobic tert-butyl groups. It is known for its antioxidant properties, making it useful in various applications, including as a stabilizer in plastics and as an additive in cosmetics and personal care products. The presence of the hydroxyl group contributes to its acidity, allowing it to participate in various chemical reactions. Additionally, its bulky tert-butyl groups enhance its steric hindrance, which can influence its reactivity and interactions with other molecules. Overall, this compound is of interest in both industrial and research settings due to its functional properties and potential applications.
Formula:C15H22O3
InChI:InChI=1S/C15H22O3/c1-14(2,3)9-7-10(13(17)18)12(16)11(8-9)15(4,5)6/h7-8,16H,1-6H3,(H,17,18)
InChI key:InChIKey=ZWQBZEFLFSFEOS-UHFFFAOYSA-N
SMILES:C(C)(C)(C)C1=C(O)C(C(O)=O)=CC(C(C)(C)C)=C1
Synonyms:- 2-Hydroxy-3,5-di-tert-butylbenzoic acid
- 3,5-Bis(1,1-dimethylethyl)-2-hydroxybenzoic acid
- 3,5-Bis-Tert-Butylsalicylic Acid
- 3,5-DI-Tert-Butyl-2-Hydroxybenzoic Acid
- 3,5-Di(tert-butyl)-2-hydroxybenzenecarboxylic acid
- 3,5-Di-Tert-Butyl-2,4-Dihydroxybenzoic Acid
- 3,5-Di-ter-butyl-2-hydroxybenzoic acid
- 3,5-Di-tert-butylsalicylic acid
- 3,5-Di-tert-butylsalicylic acid hydrate
- 3,5-Ditert-butyl-2-hydroxybenzoic acid
- 3,5-Tert-Dibutylsalicylic Acid
- 3,5-di-tert-Butylesaliylic acid/3,5-tert-Dibutyl Salicylic Acid
- Benzoic acid, 3,5-bis(1,1-dimethylethyl)-2-hydroxy-
- D 1947
- Salicylic acid, 3,5-di-tert-butyl-
- Tci-D 1947
- Tetrabutyl Ammoniumfluoride Anhydrous, Pentahydrate, Trihydrate
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3,5-Di-tert-butylsalicylic Acid
CAS:Formula:C15H22O3Purity:>98.0%(GC)(T)Color and Shape:White to Light yellow powder to crystalineMolecular weight:250.34Benzoic acid, 3,5-bis(1,1-dimethylethyl)-2-hydroxy-
CAS:Formula:C15H22O3Purity:95%Color and Shape:SolidMolecular weight:250.33343,5-Bis-tert-butylsalicylic acid
CAS:3,5-Bis-tert-butylsalicylic acid
Purity:98+%Molecular weight:250.34g/mol3,5-Di-tert-butylsalicylic acid
CAS:Formula:C15H22O3Purity:95%Color and Shape:Solid, Crystalline Powder or PowderMolecular weight:250.3383,5-tert-Dibutyl salicylic acid
CAS:3,5-tert-Dibutyl salicylic acid is a cationic polymerization agent that can be used to synthesize polymers and copolymers. 3,5-TBSA is soluble in methanol and is used as a solvent for the synthesis of polymers. The magnetic properties of 3,5-TBSA are due to the presence of superparamagnetic iron ions. These ions are bound by hydrogen bonds in the crystal lattice, which may be disrupted by changes in pH or redox potential. 3,5-TBSA has been shown to have anticancer activity when coupled with receptor α (RARα) ligands. These receptors bind with high affinity to hydroxy groups on the polymer backbone and control the rate of polymerization reactions.
Formula:C15H22O3Purity:Min. 95%Color and Shape:PowderMolecular weight:250.33 g/mol




