CAS 19717-43-2: 1,2-bis(4-bromophenyl)hydrazine

Description: 1,2-Bis(4-bromophenyl)hydrazine is an organic compound characterized by its hydrazine functional group and two para-bromophenyl substituents. This compound typically appears as a solid at room temperature and is known for its potential applications in organic synthesis and as a precursor in the development of various pharmaceuticals and agrochemicals. The presence of bromine atoms enhances its reactivity and can influence its electronic properties, making it useful in various chemical reactions, including coupling reactions and as a building block for more complex molecules. Additionally, the compound may exhibit specific physical properties such as solubility in organic solvents, while its hydrazine moiety can impart certain biological activities. Safety considerations are important when handling this compound, as hydrazines are generally considered to be toxic and potentially carcinogenic. Proper safety protocols should be followed to mitigate risks associated with exposure. Overall, 1,2-bis(4-bromophenyl)hydrazine is a significant compound in the field of synthetic organic chemistry.

Formula: C₁₂H₁₀Br₂N₂

InChI: InChI=1/C12H10Br2N2/c13-9-1-5-11(6-2-9)15-16-12-7-3-10(14)4-8-12/h1-8,15-16H

Hydrazine, 1,2-bis(4-bromophenyl)-

CAS: 19717-43-2

• Formula: C₁₂H₁₀Br₂N₂
• Molecular weight: 342.0292

Evocalcet Impurity 2

CAS: 19717-43-2

• Formula: C₁₂H₁₀Br₂N₂
• Molecular weight: 342.03