CAS 197223-39-5
:(3,5-di-tert-butylphenyl)boronic acid
Description:
(3,5-Di-tert-butylphenyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is further substituted with two tert-butyl groups at the 3 and 5 positions. This structure imparts significant steric hindrance, which can influence its reactivity and solubility. The compound is typically a white to off-white solid at room temperature and is soluble in organic solvents such as dichloromethane and ethanol, but less soluble in water due to the hydrophobic nature of the tert-butyl groups. It is commonly used in organic synthesis, particularly in Suzuki-Miyaura cross-coupling reactions, where it serves as a boron source for the formation of carbon-carbon bonds. The presence of the boronic acid group allows for the formation of stable complexes with diols, making it useful in various applications, including sensor technology and materials science. Additionally, its unique structure may confer specific properties that can be exploited in medicinal chemistry and polymer science.
Formula:C14H23BO2
InChI:InChI=1/C14H23BO2/c1-13(2,3)10-7-11(14(4,5)6)9-12(8-10)15(16)17/h7-9,16-17H,1-6H3
SMILES:CC(C)(C)c1cc(cc(c1)B(O)O)C(C)(C)C
Synonyms:- 3,5-Di-Tert-Butylphenylboronic Acid
- Boronic acid, B-[3,5-bis(1,1-dimethylethyl)phenyl]-
- 3,5-Di-t-butylphenylboronic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Boronic acid, B-[3,5-bis(1,1-dimethylethyl)phenyl]-
CAS:Formula:C14H23BO2Purity:98%Color and Shape:SolidMolecular weight:234.1422Ref: IN-DA002AOE
1g27.00€5g52.00€10g66.00€1kgTo inquire25g120.00€50g171.00€5kgTo inquire100g318.00€250gTo inquire500gTo inquire250mg21.00€3,5-Di-tert-butylphenylboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C14H23BO2Color and Shape:White to Light yellow powder to crystalMolecular weight:234.15(3,5-Di-tert-butylphenyl)boronic acid
CAS:(3,5-Di-tert-butylphenyl)boronic acidFormula:C14H23BO2Purity:97%Color and Shape: white solidMolecular weight:234.14g/mol(3,5-Di-tert-butylphenyl)boronic acid
CAS:Formula:C14H23BO2Purity:95%Color and Shape:SolidMolecular weight:234.15(3,5-Di-tert-butylphenyl)boronic acid
CAS:3,5-Di-tert-butylphenylboronic acid is a colorless solid that emits light when heated. It has been used as a fluorescent probe for boronate esters, and can be synthesized by reacting 3,5-di-tert-butylphenol with boric acid. This material has also been used to prepare nanoparticles of various sizes for use in the study of emission. The emission spectrum of 3,5-Di-tert-butylphenylboronic acid is reversible and its temperature range is from -20 to 100 degrees Celsius.
Formula:C14H23BO2Purity:Min. 95%Molecular weight:234.14 g/mol




