CAS 197223-39-5

(3,5-di-tert-butylphenyl)boronic acid

Description:

(3,5-Di-tert-butylphenyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is further substituted with two tert-butyl groups at the 3 and 5 positions. This structure imparts significant steric hindrance, which can influence its reactivity and solubility. The compound is typically a white to off-white solid at room temperature and is soluble in organic solvents such as dichloromethane and ethanol, but less soluble in water due to the hydrophobic nature of the tert-butyl groups. It is commonly used in organic synthesis, particularly in Suzuki-Miyaura cross-coupling reactions, where it serves as a boron source for the formation of carbon-carbon bonds. The presence of the boronic acid group allows for the formation of stable complexes with diols, making it useful in various applications, including sensor technology and materials science. Additionally, its unique structure may confer specific properties that can be exploited in medicinal chemistry and polymer science.

Formula: C₁₄H₂₃BO₂

InChI: InChI=1/C14H23BO2/c1-13(2,3)10-7-11(14(4,5)6)9-12(8-10)15(16)17/h7-9,16-17H,1-6H3

SMILES: CC(C)(C)c1cc(cc(c1)B(O)O)C(C)(C)C

Synonyms:

• 3,5-Di-Tert-Butylphenylboronic Acid
• Boronic acid, B-[3,5-bis(1,1-dimethylethyl)phenyl]-
• 3,5-Di-t-butylphenylboronic acid

Boronic acid, B-[3,5-bis(1,1-dimethylethyl)phenyl]-

CAS: 197223-39-5

Formula: C₁₄H₂₃BO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 234.1422

Ref: IN-DA002AOE

3,5-Di-tert-butylphenylboronic Acid (contains varying amounts of Anhydride)

CAS: 197223-39-5

Formula: C₁₄H₂₃BO₂

Color and Shape: White to Light yellow powder to crystal

Molecular weight: 234.15

Ref: 3B-D5072

(3,5-Di-tert-butylphenyl)boronic acid

CAS: 197223-39-5

(3,5-Di-tert-butylphenyl)boronic acid

Formula: C₁₄H₂₃BO₂

Purity: 97%

Color and Shape: white solid

Molecular weight: 234.14g/mol

Ref: 54-OR350137

(3,5-Di-tert-butylphenyl)boronic acid

CAS: 197223-39-5

Formula: C₁₄H₂₃BO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 234.15

Ref: 10-F211543

(3,5-Di-tert-butylphenyl)boronic acid

CAS: 197223-39-5

3,5-Di-tert-butylphenylboronic acid is a colorless solid that emits light when heated. It has been used as a fluorescent probe for boronate esters, and can be synthesized by reacting 3,5-di-tert-butylphenol with boric acid. This material has also been used to prepare nanoparticles of various sizes for use in the study of emission. The emission spectrum of 3,5-Di-tert-butylphenylboronic acid is reversible and its temperature range is from -20 to 100 degrees Celsius.

Formula: C₁₄H₂₃BO₂

Purity: Min. 95%

Molecular weight: 234.14 g/mol

Ref: 3D-FD143544