CAS 197247-23-7
:Dinor-oxo-phytodienoic acid
Description:
Dinor-oxo-phytodienoic acid (DN-OPDA) is a plant-derived compound that plays a significant role in the signaling pathways associated with plant responses to stress, particularly in the context of jasmonate biosynthesis. It is a derivative of phytodienoic acid, which is involved in the regulation of plant defense mechanisms against herbivores and pathogens. DN-OPDA is characterized by its unique structure, which includes multiple double bonds and functional groups that contribute to its reactivity and biological activity. This compound is known to influence various physiological processes, including growth regulation and the activation of defense genes. Its presence in plants is often associated with stress responses, making it a key player in plant physiology and biochemistry. Additionally, DN-OPDA can serve as a precursor for the synthesis of other bioactive compounds, further underscoring its importance in plant metabolism and adaptation. Understanding its characteristics and functions can provide insights into plant resilience and the development of agricultural strategies to enhance crop protection.
Formula:C16H24O3
InChI:InChI=1S/C16H24O3/c1-2-3-5-9-14-13(11-12-15(14)17)8-6-4-7-10-16(18)19/h3,5,11-14H,2,4,6-10H2,1H3,(H,18,19)/b5-3-/t13-,14-/m0/s1
InChI key:InChIKey=SZVNKXCDJUBPQO-DWMAKUKJSA-N
SMILES:C(CCCCC(O)=O)[C@@H]1[C@H](C/C=C\CC)C(=O)C=C1
Synonyms:- 2-Cyclopentene-1-hexanoic acid, 4-oxo-5-(2Z)-2-penten-1-yl-, (1S,5S)-
- Dinor-oxo-phytodienoic acid
- (1S,5S)-4-Oxo-5-(2Z)-2-penten-1-yl-2-cyclopentene-1-hexanoic acid
- 2-Cyclopentene-1-hexanoic acid, 4-oxo-5-(2Z)-2-pentenyl-, (1S,5S)-
- 2-Cyclopentene-1-hexanoic acid, 4-oxo-5-(2-pentenyl)-, (Z)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2,3-Dinor-12-oxo-10,15(Z)-phytodienoic acid
CAS:Formula:C16H24O3Purity:>98%Color and Shape:In solution, EthanolMolecular weight:264.36Dinor-12-oxo-phytodienoic Acid
CAS:Controlled ProductFormula:C16H24O3Color and Shape:NeatMolecular weight:264.36dinor-12-oxo Phytodienoic Acid
CAS:1dinor-12-oxo-Phytodienoic acid (dinor-OPDA) serves as an intermediate in the biosynthesis of jasmonic acid from hexadecatrienoic acid, playing a crucial role in the jasmonate pathway in plants. This pathway oxygenates and modifies certain unsaturated fatty acids to produce plant hormones critical for processes such as senescence, flower development, mechanotransduction, and response to herbivory. Additionally, dinor-OPDA can be incorporated into glycerolipids and galactolipids, including specific arabidopsides.Formula:C16H24O3Color and Shape:SolidMolecular weight:264.365


