CymitQuimica logo

CAS 19728-22-4

:

2-(5-Formyl-2-methoxyphenoxy)acetic acid

Description:
2-(5-Formyl-2-methoxyphenoxy)acetic acid, with the CAS number 19728-22-4, is an organic compound characterized by its unique functional groups and structural features. It contains a phenoxy group, which is a phenol derivative, linked to an acetic acid moiety. The presence of a formyl group indicates that it has an aldehyde functional group, contributing to its reactivity and potential applications in organic synthesis. The methoxy group enhances its solubility in organic solvents and may influence its biological activity. This compound is typically used in research settings, particularly in the synthesis of more complex molecules or as an intermediate in various chemical reactions. Its properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and purity of the sample. Overall, 2-(5-Formyl-2-methoxyphenoxy)acetic acid is of interest in both synthetic organic chemistry and potential pharmaceutical applications due to its structural characteristics.
Formula:C10H10O5
InChI:InChI=1S/C10H10O5/c1-14-8-3-2-7(5-11)4-9(8)15-6-10(12)13/h2-5H,6H2,1H3,(H,12,13)
InChI key:InChIKey=GCUIYKXCCXKSRU-UHFFFAOYSA-N
SMILES:O(CC(O)=O)C1=C(OC)C=CC(C=O)=C1
Synonyms:
  • Acetic acid, (5-formyl-2-methoxyphenoxy)-
  • (3-Formyl-6-methoxyphenoxy)acetic acid
  • Acetic acid, 2-(5-formyl-2-methoxyphenoxy)-
  • 2-(5-Formyl-2-methoxyphenoxy)acetic acid
  • (5-Formyl-2-methoxy-phenoxy)-acetic acid
Found 5 products.