CAS 197304-01-1

2′,3′-Dihydro-3,3′,5,7-tetrahydroxy-2′,2′-dimethyl[2,6′-bi-4H-1-benzopyran]-4-one

Description:

2′,3′-Dihydro-3,3′,5,7-tetrahydroxy-2′,2′-dimethyl[2,6′-bi-4H-1-benzopyran]-4-one, also known by its CAS number 197304-01-1, is a synthetic compound belonging to the class of flavonoids, which are known for their diverse biological activities. This compound features a complex polyphenolic structure characterized by multiple hydroxyl groups, contributing to its potential antioxidant properties. The presence of the benzopyran moiety suggests that it may exhibit various pharmacological effects, including anti-inflammatory and anticancer activities. Its solubility and stability can vary depending on the solvent and environmental conditions, which is crucial for its application in research and potential therapeutic uses. Additionally, the compound's unique structural features may influence its interaction with biological systems, making it a subject of interest in medicinal chemistry and natural product research. Further studies are necessary to fully elucidate its mechanisms of action and potential applications in health and disease.

Formula: C₂₀H₁₈O₇

InChI: InChI=1S/C20H18O7/c1-20(2)15(23)6-10-5-9(3-4-13(10)27-20)19-18(25)17(24)16-12(22)7-11(21)8-14(16)26-19/h3-5,7-8,15,21-23,25H,6H2,1-2H3

InChI key: InChIKey=UFWHTSBKDGUFOX-UHFFFAOYSA-N

SMILES: OC1=C(OC=2C(C1=O)=C(O)C=C(O)C2)C=3C=C4C(=CC3)OC(C)(C)C(O)C4

Synonyms:

• [2,6′-Bi-4H-1-benzopyran]-4-one, 2′,3′-dihydro-3,3′,5,7-tetrahydroxy-2′,2′-dimethyl-
• 2′,3′-Dihydro-3,3′,5,7-tetrahydroxy-2′,2′-dimethyl[2,6′-bi-4H-1-benzopyran]-4-one
• Glycyrrhiza flavonol A
• 3,5,7-Trihydroxy-2-(3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-6-yl)chromen-4-one

Glycyrrhiza flavonol A

CAS: 197304-01-1

Glycyrrhiza flavonol A is a natural product of Glycyrrhiza, Fabaceae.

Formula: C₂₀H₁₈O₇

Purity: 98%

Color and Shape: Solid

Molecular weight: 370.35

Ref: TM-TN4150

Glycyrrhiza flavonol A

CAS: 197304-01-1

Glycyrrhiza flavonol A is a specialized flavonoid compound, which is derived from the roots of the Glycyrrhiza plant, commonly known as licorice. As a naturally occurring bioactive compound, Glycyrrhiza flavonol A exhibits potential pharmacological effects, primarily due to its modulating influence on inflammation pathways. The mode of action of Glycyrrhiza flavonol A involves the inhibition of specific enzymes and signaling molecules that play a critical role in the inflammatory response, such as the NF-kB pathway.

Formula: C₂₀H₁₈O₇

Purity: Min. 95%

Molecular weight: 370.40 g/mol

Ref: 3D-XHA30401