CymitQuimica logo

CAS 197306-80-2

:

Bodipy Tr-X

Description:
Bodipy Tr-X, with the CAS number 197306-80-2, is a fluorescent dye known for its vibrant color and stability, making it widely used in various applications, including biological imaging and sensing. This compound belongs to the boron-dipyrromethene (BODIPY) family, characterized by a boron atom coordinated to a dipyrromethene moiety, which contributes to its strong fluorescence properties. Bodipy Tr-X exhibits high molar absorptivity and quantum yield, allowing for effective light absorption and emission. Its photostability is another significant characteristic, enabling prolonged use in experimental conditions without significant degradation. Additionally, the compound is often functionalized to enhance solubility and target specific biological systems, making it valuable in research fields such as biochemistry and molecular biology. The versatility of Bodipy Tr-X in various solvents and its compatibility with different biological environments further underscore its importance in scientific studies, particularly in fluorescence microscopy and as a probe for detecting specific biomolecules.
Formula:C31H29BF2N4O6S
InChI:InChI=1S/C31H29BF2N4O6S/c33-32(34)36-22(19-23-10-14-26(37(23)32)27-5-4-18-45-27)9-13-25(36)21-7-11-24(12-8-21)43-20-28(39)35-17-3-1-2-6-31(42)44-38-29(40)15-16-30(38)41/h4-5,7-14,18-19H,1-3,6,15-17,20H2,(H,35,39)
InChI key:InChIKey=NCYPKNAEMUYMBG-UHFFFAOYSA-N
SMILES:[F-][B+3]1([F-])[N-]2C(=CC=C2C=C3[N]1=C(C=C3)C4=CC=CS4)C5=CC=C(OCC(NCCCCCC(ON6C(=O)CCC6=O)=O)=O)C=C5
Synonyms:
  • BDY TR-X, SE
  • (T-4)-[N-[6-[(2,5-Dioxo-1-pyrrolidinyl)oxy]-6-oxohexyl]-2-[4-[5-[[5-(2-thienyl)-2H-pyrrol-2-ylidene-κN]methyl]-1H-pyrrol-2-yl-κN]phenoxy]acetamidato]difluoroboron
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.