CAS 19731-02-3
:1H-Benzimidazole-2-acetic acid, hydrazide
Description:
1H-Benzimidazole-2-acetic acid, hydrazide is a chemical compound characterized by its benzimidazole core, which is a bicyclic structure containing a fused benzene and imidazole ring. This compound features an acetic acid moiety and a hydrazide functional group, contributing to its potential biological activity. It is typically a white to off-white solid and is soluble in polar solvents, which may include water and alcohols, depending on the specific conditions. The presence of the hydrazide group suggests potential reactivity, particularly in forming hydrazones or undergoing condensation reactions. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its CAS number, 19731-02-3, is a unique identifier that facilitates the search for information regarding its synthesis, applications, and safety data. As with many chemical substances, handling should be conducted with care, following appropriate safety protocols to mitigate any risks associated with its use.
Formula:C9H10N4O
InChI:InChI=1S/C9H10N4O/c10-13-9(14)5-8-11-6-3-1-2-4-7(6)12-8/h1-4H,5,10H2,(H,11,12)(H,13,14)
InChI key:InChIKey=AAQMWDANTBEUPJ-UHFFFAOYSA-N
SMILES:C(C(NN)=O)C=1NC=2C(N1)=CC=CC2
Synonyms:- 1H-Benzimidazole-2-acetic acid, hydrazide
- 1H-Benzimidazole-2-aceticacid,hydrazide(9CI)
- 2-(1H-1,3-Benzodiazol-2-yl)acetohydrazide
- 2-(1H-Benzo[d]imidazol-2-yl)acetohydrazide
- 2-(1H-benzimidazol-2-yl)acetohydrazide
- 2-Benzimidazoleacetic acid, hydrazide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
2-(1H-1,3-Benzodiazol-2-yl)acetohydrazide
CAS:Controlled ProductFormula:C9H10N4OColor and Shape:NeatMolecular weight:190.202

