CAS 197370-13-1

2-Bromothiophene-3-carbonyl chloride

Description:

2-Bromothiophene-3-carbonyl chloride is an organic compound characterized by its unique structure, which includes a thiophene ring substituted with a bromine atom and a carbonyl chloride functional group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is known for its reactivity, particularly due to the presence of the carbonyl chloride group, which can participate in nucleophilic acyl substitution reactions. The bromine atom enhances the electrophilicity of the carbonyl carbon, making it a useful intermediate in organic synthesis, particularly in the preparation of various pharmaceuticals and agrochemicals. Additionally, 2-Bromothiophene-3-carbonyl chloride is soluble in organic solvents such as dichloromethane and ether, but it is generally insoluble in water. Safety precautions should be taken when handling this compound, as it can be corrosive and may release harmful gases upon hydrolysis. Proper storage in a cool, dry place away from moisture is recommended to maintain its stability.

Formula: C₅H₂BrClOS

InChI: InChI=1/C5H2BrClOS/c6-4-3(5(7)8)1-2-9-4/h1-2H

SMILES: c1csc(c1C(=O)Cl)Br

2-Bromothiophene-3-carbonyl chloride

CAS: 197370-13-1

Formula: C₅H₂BrClOS

Molecular weight: 225.4908

Ref: IN-DA002ASE

2-Bromothiophene-3-carbonyl chloride

CAS: 197370-13-1

2-Bromothiophene-3-carbonyl chloride

Purity: ≥95%

Color and Shape: Powder

Molecular weight: 225.49g/mol

Ref: 54-OR5220