CAS 197438-99-6

(3-chlorophenyl)[4-(methylsulfanyl)phenyl]methanone

Description:

The chemical substance known as (3-chlorophenyl)[4-(methylsulfanyl)phenyl]methanone, with the CAS number 197438-99-6, is an organic compound characterized by its complex structure featuring a ketone functional group. It consists of a phenyl ring substituted with a chlorine atom at the meta position and another phenyl ring that has a methylthio group at the para position. This compound exhibits properties typical of aromatic ketones, including potential reactivity in electrophilic substitution reactions due to the presence of the electron-withdrawing chlorine atom and the electron-donating methylthio group. Its molecular structure suggests it may have applications in pharmaceuticals or as an intermediate in organic synthesis. Additionally, the presence of sulfur in the methylthio group can influence the compound's solubility and reactivity. As with many organic compounds, safety and handling precautions should be observed, particularly regarding its potential toxicity and environmental impact.

Formula: C₁₄H₁₁ClOS

InChI: InChI=1/C14H11ClOS/c1-17-13-7-5-10(6-8-13)14(16)11-3-2-4-12(15)9-11/h2-9H,1H3

SMILES: CSc1ccc(cc1)C(=O)c1cccc(c1)Cl

Synonyms:

• Methanone, (3-chlorophenyl)[4-(methylthio)phenyl]-

3-Chloro-4′-(methylthio)benzophenone

CAS: 197438-99-6

Formula: C₁₄H₁₁ClOS

Purity: 97.0%

Molecular weight: 262.75

Ref: 10-F022710