CAS 197439-23-9

(3-bromophenyl)[4-(methylsulfanyl)phenyl]methanone

Description:

(3-bromophenyl)[4-(methylsulfanyl)phenyl]methanone, with the CAS number 197439-23-9, is an organic compound characterized by its complex structure featuring a ketone functional group. This compound consists of a phenyl ring substituted with a bromine atom at the meta position and another phenyl ring that has a methylthio group at the para position. The presence of the bromine atom introduces notable electrophilic properties, while the methylthio group can influence the compound's reactivity and solubility. The ketone functional group contributes to the compound's potential as a reactive intermediate in various chemical reactions, including nucleophilic additions. This compound may exhibit interesting biological activities, making it of interest in medicinal chemistry and material science. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific interactions of its functional groups and overall molecular structure. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₄H₁₁BrOS

InChI: InChI=1/C14H11BrOS/c1-17-13-7-5-10(6-8-13)14(16)11-3-2-4-12(15)9-11/h2-9H,1H3

SMILES: CSc1ccc(cc1)C(=O)c1cccc(c1)Br

Synonyms:

• Methanone, (3-bromophenyl)[4-(methylthio)phenyl]-

3-Bromo-4′-(methylthio)benzophenone

CAS: 197439-23-9

Formula: C₁₄H₁₁BrOS

Purity: 97.0%

Molecular weight: 307.21

Ref: 10-F022686