CAS 197439-28-4

(4-bromophenyl)[4-(methylsulfanyl)phenyl]methanone

Description:

(4-bromophenyl)[4-(methylsulfanyl)phenyl]methanone, with the CAS number 197439-28-4, is an organic compound characterized by its complex structure, which includes a ketone functional group and two aromatic rings. The presence of a bromine atom on one phenyl ring and a methylthio group on the other contributes to its unique chemical properties, including potential reactivity and solubility characteristics. This compound is likely to exhibit moderate to high lipophilicity due to the aromatic systems, which can influence its behavior in biological systems and its interactions with other molecules. The methylsulfanyl group may also impart specific electronic effects, affecting the compound's reactivity in substitution reactions. Additionally, the compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of functional groups that can participate in various chemical reactions. Overall, (4-bromophenyl)[4-(methylsulfanyl)phenyl]methanone is a versatile compound with interesting chemical properties that warrant further investigation.

Formula: C₁₄H₁₁BrOS

InChI: InChI=1/C14H11BrOS/c1-17-13-8-4-11(5-9-13)14(16)10-2-6-12(15)7-3-10/h2-9H,1H3

SMILES: CSc1ccc(cc1)C(=O)c1ccc(cc1)Br

Synonyms:

• Methanone, (4-bromophenyl)[4-(methylthio)phenyl]-
• (4-Bromophenyl)[4-(methylsulfanyl)phenyl]methanone

4-Bromo-4′-(methylthio)benzophenone

CAS: 197439-28-4

Formula: C₁₄H₁₁BrOS

Purity: 97.0%

Molecular weight: 307.21

Ref: 10-F022664