CAS 197449-09-5
:(2R,3R,4R)-2-Methyl-3,4-piperidinediol
Description:
(2R,3R,4R)-2-Methyl-3,4-piperidinediol is a chiral organic compound characterized by its piperidine ring structure, which features hydroxyl groups at the 3 and 4 positions and a methyl group at the 2 position. This compound is typically a white to off-white solid and is soluble in water due to the presence of hydroxyl groups, which can form hydrogen bonds. Its stereochemistry, indicated by the (2R,3R,4R) configuration, plays a crucial role in its biological activity and interactions. The presence of multiple functional groups suggests potential applications in pharmaceuticals, particularly in the development of chiral drugs. The compound may exhibit specific optical activity, making it important in stereochemical studies. Additionally, its synthesis and characterization are of interest in organic chemistry, particularly in the context of asymmetric synthesis and the study of piperidine derivatives. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C6H13NO2
InChI:InChI=1S/C6H13NO2/c1-4-6(9)5(8)2-3-7-4/h4-9H,2-3H2,1H3/t4-,5-,6-/m1/s1
InChI key:InChIKey=RMJCALHKIHCSMY-HSUXUTPPSA-N
SMILES:O[C@H]1[C@H](O)CCN[C@@H]1C
Synonyms:- 3,4-Piperidinediol, 2-methyl-, (2R,3R,4R)-
- 3,4-Piperidinediol, 2-methyl-, [2R-(2α,3β,4α)]-
- (2R,3R,4R)-2-Methyl-3,4-piperidinediol
- 6-Deoxyfagomine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
6-Deoxyfagomine Hydrochloride
CAS:Controlled ProductFormula:C6H13NO2·HClColor and Shape:NeatMolecular weight:167.634
