CAS 1975-44-6

5-NITRO-NAPHTHALENE-1-CARBOXYLIC ACID

Description:

5-Nitro-naphthalene-1-carboxylic acid is an organic compound characterized by its naphthalene backbone, which features a nitro group and a carboxylic acid functional group. This compound typically appears as a solid at room temperature and is known for its yellowish color. The presence of the nitro group introduces significant electron-withdrawing properties, influencing the compound's reactivity and solubility in various solvents. It is generally soluble in organic solvents like ethanol and acetone but may have limited solubility in water due to the hydrophobic nature of the naphthalene structure. The carboxylic acid group contributes to its acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. Additionally, 5-nitro-naphthalene-1-carboxylic acid can serve as an intermediate in the synthesis of dyes, pharmaceuticals, and agrochemicals. Safety precautions should be observed when handling this compound, as nitro compounds can be hazardous and may pose environmental risks.

Formula: C₁₁H₇NO₄

InChI: InChI=1/C11H7NO4/c13-11(14)9-5-1-4-8-7(9)3-2-6-10(8)12(15)16/h1-6H,(H,13,14)

SMILES: c1cc2c(cccc2N(=O)=O)c(c1)C(=O)O

Synonyms:

• 1-Naphthalenecarboxylic Acid, 5-Nitro-
• 5-Nitro-1-naphthoic acid
• 5-Nitronaphthalene-1-carboxylic acid

1-Naphthalenecarboxylic acid, 5-nitro-

CAS: 1975-44-6

Formula: C₁₁H₇NO₄

Purity: 97%

Color and Shape: Solid

Molecular weight: 217.1776

Ref: IN-DA002AUN

5-Nitro-naphthalene-1-carboxylic acid

CAS: 1975-44-6

5-Nitro-naphthalene-1-carboxylic acid

Purity: 97%

Molecular weight: 217.18g/mol

Ref: 54-OR1042450

5-Nitro-naphthalene-1-carboxylic acid

CAS: 1975-44-6

Purity: 97%

Molecular weight: 217.18

Ref: 10-F988525

5-NITRONAPHTHALENE-1-CARBOXYLIC ACID

CAS: 1975-44-6

Formula: C₁₁H₇NO₄

Purity: 97%

Color and Shape: Solid

Molecular weight: 217.18

Ref: 10-F334015