CAS 197507-59-8

1,6-Naphthyridine-2-carboxylic acid

Description:

1,6-Naphthyridine-2-carboxylic acid is a heterocyclic organic compound characterized by a fused bicyclic structure containing nitrogen atoms in the ring system. This compound features a carboxylic acid functional group (-COOH) at the 2-position of the naphthyridine ring, which contributes to its acidic properties. The presence of nitrogen in the ring enhances its potential for forming hydrogen bonds and participating in various chemical reactions, making it a valuable intermediate in organic synthesis. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the carboxylic acid group. The compound is of interest in medicinal chemistry and material science, as derivatives of naphthyridine are known for their biological activity, including antimicrobial and antitumor properties. Additionally, its unique structure allows for potential applications in the development of pharmaceuticals and agrochemicals. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₉H₆N₂O₂

InChI: InChI=1/C9H6N2O2/c12-9(13)8-2-1-6-5-10-4-3-7(6)11-8/h1-5H,(H,12,13)/p-1

SMILES: c1cc(C(=O)[O-])nc2ccncc12

Synonyms:

• 1,6-Naphthyridine-2-Carboxylate
• [1,6]Naphthyridine-2-carboxylic acid
• 1,6phthyridine-2-carboxylic acid
• 1,6-Naphthyridine-2-carboxylic acid 95+%
• 2-Carboxy-1,6-naphthyridine

1,6-NAPHTHYRIDINE-2-CARBOXYLICACID

CAS: 197507-59-8

Formula: C₉H₆N₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 174.1561

Ref: IN-DA002AV0

1,6-Naphthyridine-2-carboxylic acid

CAS: 197507-59-8

1,6-Naphthyridine-2-carboxylic acid

Purity: 97%

Color and Shape: Solid

Molecular weight: 174.16g/mol

Ref: 54-OR5998

1,6-Naphthyridine-2-carboxylic acid

CAS: 197507-59-8

Formula: C₉H₆N₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 174.159

Ref: 10-F023690