CAS 197509-46-9

Laniquidar

Description:

Laniquidar, with the CAS number 197509-46-9, is a chemical compound known for its role as a multidrug resistance modulator. It primarily functions as an inhibitor of P-glycoprotein, a membrane protein that plays a significant role in the efflux of various drugs from cells, thereby affecting their bioavailability and therapeutic efficacy. Laniquidar has been investigated for its potential to enhance the effectiveness of chemotherapeutic agents by preventing their expulsion from cancer cells, which can lead to improved treatment outcomes in resistant tumors. The compound is characterized by its specific molecular structure, which allows it to interact with the P-glycoprotein transporter. In terms of physical properties, Laniquidar is typically a solid at room temperature and has a moderate solubility in organic solvents. Its pharmacokinetic profile and safety profile are subjects of ongoing research, particularly in the context of cancer therapy and the management of drug resistance.

Formula: C₃₇H₃₆N₄O₃

InChI: InChI=1S/C37H36N4O3/c1-43-37(42)34-24-38-36-35(32-8-4-2-6-27(32)19-23-41(34)36)29-17-21-40(22-18-29)20-16-26-10-14-31(15-11-26)44-25-30-13-12-28-7-3-5-9-33(28)39-30/h2-15,24H,16-23,25H2,1H3

InChI key: InChIKey=TULGGJGJQXESOO-UHFFFAOYSA-N

SMILES: C(OC)(=O)C=1N2C(C(C=3C(CC2)=CC=CC3)=C4CCN(CCC5=CC=C(OCC6=NC7=C(C=C6)C=CC=C7)C=C5)CC4)=NC1

Synonyms:

• 5H-Imidazo[2,1-b][3]benzazepine-3-carboxylic acid, 6,11-dihydro-11-[1-[2-[4-(2-quinolinylmethoxy)phenyl]ethyl]-4-piperidinylidene]-, methyl ester
• Laniquidar

Laniquidar

CAS: 197509-46-9

Laniquidar is a pharmacological agent classified as a third-generation multidrug resistance (MDR) modulator. It is derived from a class of compounds specifically designed to overcome MDR in cancer by targeting P-glycoprotein, a well-known efflux transporter protein. Laniquidar functions by inhibiting the action of P-glycoprotein, which is often overexpressed in various cancer cells and facilitates the efflux of chemotherapeutic drugs, thereby reducing their intracellular concentrations and effectiveness.

Formula: C₃₇H₃₆N₄O₃

Purity: Min. 95%

Molecular weight: 584.7 g/mol

Ref: 3D-XHA50946

Laniquidar

CAS: 197509-46-9

Laniquidar (R101933) inhibits P-glycoprotein (IC50: 0.51 μM), poor oral bioavailability, modulates drug resistance transporters.

Formula: C₃₇H₃₆N₄O₃

Color and Shape: Solid

Molecular weight: 584.71

Ref: TM-T64133