CAS 19757-64-3

N-CYCLOPROPYLUREA

Description:

N-Cyclopropylurea is an organic compound characterized by its unique cyclopropyl group attached to a urea moiety. It typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to the presence of the urea functional group, which can engage in hydrogen bonding. The cyclopropyl group contributes to its distinct chemical reactivity and steric properties, making it of interest in various chemical syntheses and applications. N-Cyclopropylurea may exhibit biological activity, which has led to investigations in medicinal chemistry, particularly in the development of pharmaceuticals. Its molecular structure allows for potential interactions with biological targets, making it a candidate for further research in drug design. As with many chemical substances, handling N-cyclopropylurea requires appropriate safety measures due to potential toxicity or reactivity, emphasizing the importance of understanding its properties in both laboratory and industrial settings.

Formula: C₄H₈N₂O

InChI: InChI=1/C4H8N2O/c5-4(7)6-3-1-2-3/h3H,1-2H2,(H3,5,6,7)

SMILES: C1CC1NC(=N)O

Synonyms:

• 1-Cyclopropylurea

Urea, N-cyclopropyl-

CAS: 19757-64-3

Formula: C₄H₈N₂O

Purity: 97%

Color and Shape: Solid

Molecular weight: 100.1191

Ref: IN-DA002AWR

1-Cyclopropylurea

CAS: 19757-64-3

1-Cyclopropylurea

Formula: C₄H₈N₂O

Purity: 96%

Color and Shape: white solid

Molecular weight: 100.12g/mol

Ref: 54-OR21332

cyclopropylurea

CAS: 19757-64-3

Formula: C₄H₈N₂O

Purity: 97%

Molecular weight: 100.121

Ref: 10-F520342

1-Cyclopropylurea

CAS: 19757-64-3

1-Cyclopropylurea is a synthetic anticancer drug that was originally developed as an antihypertensive agent. It has been shown to have inhibitory effects on cancer cells and inflammatory diseases, including cyclic nucleotide phosphodiesterase (cNPD) and b-raf. 1-Cyclopropylurea also inhibits the synthesis of epoxyeicosatrienoic acids (EETs) in vitro, suggesting that it may be useful for the treatment of cardiovascular diseases such as hypertension.
1-Cyclopropylurea has been shown to inhibit cell proliferation in culture by causing G2/M phase arrest and apoptosis. The mechanism of action of 1-cyclopropylurea is not well understood, but it has been suggested that the drug prevents the phosphorylation of b-raf, which prevents the activation of mitogen activated protein kinases (MAPKs).

Purity: Min. 95%

Ref: 3D-UAA75764