CymitQuimica logo

CAS 197573-17-4

:

Benzaldehyde, 4-(cyclopentyloxy)-3-methoxy-

Description:
Benzaldehyde, 4-(cyclopentyloxy)-3-methoxy- is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with both a methoxy group and a cyclopentyloxy group. The presence of the methoxy group (-OCH3) enhances its solubility in organic solvents and can influence its reactivity and interaction with other chemical species. The cyclopentyloxy group introduces a cyclic ether component, which can affect the compound's steric and electronic properties. This compound is likely to exhibit typical aldehyde reactivity, including oxidation to carboxylic acids and participation in nucleophilic addition reactions. Its unique structure may also impart specific biological activities or properties, making it of interest in various fields, including pharmaceuticals and materials science. The compound's physical properties, such as boiling point, melting point, and solubility, would depend on the balance of its functional groups and the overall molecular structure. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C13H16O3
InChI:InChI=1S/C13H16O3/c1-15-13-8-10(9-14)6-7-12(13)16-11-4-2-3-5-11/h6-9,11H,2-5H2,1H3
InChI key:UMIUDSWQJWYRLW-UHFFFAOYSA-N
SMILES:COC1=C(C=CC(=C1)C=O)OC2CCCC2
Found 2 products.