CAS 197584-99-9

7-hydroxy-2,3-dihydro-1,4-benzodioxine-6-carboxylic acid

Description:

7-Hydroxy-2,3-dihydro-1,4-benzodioxine-6-carboxylic acid, with the CAS number 197584-99-9, is a chemical compound characterized by its unique bicyclic structure that incorporates a benzodioxine moiety. This compound features a hydroxyl group and a carboxylic acid functional group, which contribute to its potential solubility in polar solvents and its reactivity in various chemical reactions. The presence of the hydroxyl group suggests that it may exhibit hydrogen bonding capabilities, influencing its physical properties and interactions with other molecules. Additionally, the carboxylic acid group can participate in acid-base reactions, making it a versatile compound in organic synthesis and medicinal chemistry. Its structural features may also impart biological activity, which could be of interest in pharmacological studies. Overall, 7-hydroxy-2,3-dihydro-1,4-benzodioxine-6-carboxylic acid represents a compound with potential applications in various fields, including drug development and materials science.

Formula: C₉H₈O₅

InChI: InChI=1/C9H8O5/c10-6-4-8-7(13-1-2-14-8)3-5(6)9(11)12/h3-4,10H,1-2H2,(H,11,12)

SMILES: C1COc2cc(c(cc2O1)C(=O)O)O

7-Hydroxy-1,4-benzodioxan-6-carboxylic acid

CAS: 197584-99-9

Formula: C₉H₈O₅

Purity: 97%

Color and Shape: Solid

Molecular weight: 196.1568

Ref: IN-DA00ADGG

7-Hydroxy-1,4-benzodioxan-6-carboxylic Acid

CAS: 197584-99-9

7-Hydroxy-1,4-benzodioxan-6-carboxylic Acid

Purity: 97%

Molecular weight: 196.16g/mol

Ref: 54-OR1042550

7-Hydroxy-1,4-benzodioxan-6-carboxylic Acid

Controlled Product

CAS: 197584-99-9

Applications Intermediate in the preparation of Benzoxazines.

Formula: C₉H₈O₅

Color and Shape: Neat

Molecular weight: 196.16

Ref: TR-H829190

7-Hydroxy-2,3-dihydrobenzo[b][1,4]dioxine-6-carboxylic acid

CAS: 197584-99-9

Purity: 97%

Molecular weight: 196.1580048

Ref: 10-F771636