CAS 19759-66-1

2-Amino-benzothiazole-6-carbonitrile

Description:

2-Amino-benzothiazole-6-carbonitrile is an organic compound characterized by its unique structural features, which include a benzothiazole ring and a cyano group. The presence of the amino group contributes to its potential as a building block in various chemical syntheses, particularly in the development of pharmaceuticals and agrochemicals. This compound typically exhibits properties such as moderate solubility in polar solvents and may display biological activity, making it of interest in medicinal chemistry. The benzothiazole moiety is known for its diverse applications, including its role in dyes, rubber accelerators, and as a precursor in the synthesis of various biologically active compounds. Additionally, the cyano group can participate in nucleophilic reactions, enhancing the compound's reactivity. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken. Overall, 2-Amino-benzothiazole-6-carbonitrile is a versatile compound with significant implications in chemical research and development.

Formula: C₈H₅N₃S

InChI: InChI=1/C8H5N3S/c9-4-5-1-2-6-7(3-5)12-8(10)11-6/h1-3H,(H2,10,11)

SMILES: c1cc2c(cc1C#N)sc(=N)[nH]2

Synonyms:

• 2-Amino-6-cyanobenzothiazole
• 6-Benzothiazolecarbonitrile,2-amino-(8CI,9CI)
• 2-Aminobenzo[d]thiazole-6-carbonitrile
• 2-Amino-1,3-Benzothiazole-6-Carbonitrile

6-Benzothiazolecarbonitrile, 2-amino-

CAS: 19759-66-1

Formula: C₈H₅N₃S

Purity: 96%

Color and Shape: Solid

Molecular weight: 175.2104

Ref: IN-DA002AXD

2-Aminobenzothiazole-6-carbonitrile

CAS: 19759-66-1

2-Aminobenzothiazole-6-carbonitrile

Purity: 98%

Color and Shape: Solid

Molecular weight: 175.2104g/mol

Ref: 54-OR300670

2-Aminobenzothiazole-6-carbonitrile

CAS: 19759-66-1

Formula: C₈H₅N₃S

Purity: 96%

Color and Shape: Solid

Molecular weight: 175.21

Ref: 10-F093663