
CAS 19764-02-4
:Fragilin
Description:
Fragilin, with the CAS number 19764-02-4, is a chemical compound that is primarily recognized for its role as a natural product derived from certain plant sources. It is classified as a secondary metabolite, which means it is not directly involved in the normal growth, development, or reproduction of organisms but may have ecological functions, such as defense against herbivores or pathogens. Fragilin exhibits specific structural characteristics that contribute to its biological activity, including potential antimicrobial or antifungal properties. The compound's solubility, stability, and reactivity can vary depending on environmental conditions, such as pH and temperature. Additionally, fragilin may interact with various biological systems, making it of interest in pharmacological research. Its applications could extend to agriculture, medicine, or biochemistry, although detailed studies are necessary to fully understand its mechanisms and potential uses. As with many natural products, further research is essential to explore its full range of characteristics and applications.
Formula:C15H20O8
InChI:InChI=1S/C15H20O8/c1-8(17)21-7-11-12(18)13(19)14(20)15(23-11)22-10-5-3-2-4-9(10)6-16/h2-5,11-16,18-20H,6-7H2,1H3/t11-,12-,13+,14-,15-/m1/s1
InChI key:InChIKey=IERQJNGBILWLCY-UXXRCYHCSA-N
SMILES:O([C@@H]1O[C@H](COC(C)=O)[C@@H](O)[C@H](O)[C@H]1O)C2=C(CO)C=CC=C2
Synonyms:- β-D-Glucopyranoside, 2-(hydroxymethyl)phenyl, 6-acetate
- Fragilin (glycoside)
- Fragilin
- Salicin, 6′-acetate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Fragilin
CAS:Fragilin is a phenolic glycoside.Formula:C15H20O8Color and Shape:SolidMolecular weight:328.31
