CymitQuimica logo

CAS 19765-12-9

:

2-[2-(2-methyl-4-nitro-1H-imidazol-1-yl)ethoxy]ethanol

Description:
2-[2-(2-methyl-4-nitro-1H-imidazol-1-yl)ethoxy]ethanol, with the CAS number 19765-12-9, is a chemical compound characterized by its imidazole ring, which contributes to its biological activity. This substance features a nitro group and a methyl group on the imidazole, enhancing its solubility and reactivity. The ethoxy and ethanol functional groups provide polar characteristics, making it soluble in water and various organic solvents. The presence of the nitro group suggests potential applications in pharmaceuticals, particularly in antimicrobial or antifungal agents, due to the biological activity often associated with nitro-substituted compounds. Additionally, the compound's structure indicates it may participate in hydrogen bonding, influencing its interactions with biological targets. Overall, this compound's unique structural features contribute to its potential utility in medicinal chemistry and related fields.
Formula:C8H13N3O4
InChI:InChI=1/C8H13N3O4/c1-7-9-8(11(13)14)6-10(7)2-4-15-5-3-12/h6,12H,2-5H2,1H3
SMILES:Cc1nc(cn1CCOCCO)N(=O)=O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.