CAS 19766-89-3: Sodium 2-ethylhexanoate
Description:Sodium 2-ethylhexanoate, with the CAS number 19766-89-3, is a sodium salt of 2-ethylhexanoic acid, a branched-chain fatty acid. This compound typically appears as a white to off-white solid or powder and is soluble in water, making it useful in various applications. It is known for its surfactant properties, which allow it to reduce surface tension in solutions, enhancing its effectiveness in emulsifying and dispersing agents. Sodium 2-ethylhexanoate is often utilized in the production of lubricants, coatings, and as a stabilizer in polymer formulations. Additionally, it can act as a catalyst in certain chemical reactions, particularly in the synthesis of esters and other organic compounds. The substance is generally considered to have low toxicity, but standard safety precautions should be observed when handling it, as with any chemical. Its unique structure and properties make it valuable in both industrial and research settings.
Formula:C8H16O2·Na
InChI:InChI=1S/C8H16O2.Na/c1-3-5-6-7(4-2)8(9)10;/h7H,3-6H2,1-2H3,(H,9,10);
InChI key:InChIKey=JRVKWZTUEHWGRW-UHFFFAOYSA-N
SMILES:[Na].O=C(O)C(CC)CCCC
- Synonyms:
- 2-Ethylcaproic acid sodium salt
- 2-Ethylhexanoic acid sodium salt
- 2-ethylhexanoate Sodium
- Hexanoic Acid, 2-Ethyl-, Sodium Salt (1:1)
- Hexanoic acid, 2-ethyl-, sodium salt
- Sodium 2-ethylcaproate
- Sodium isocaprylate
- Sodium 2-ethylhexanoate
