CymitQuimica logo

CAS 197662-64-9

:

ETHYL-4-(TRIETHOXYSILYL) BENZOATE

Description:
Ethyl-4-(triethoxysilyl)benzoate, with the CAS number 197662-64-9, is an organosilicon compound characterized by the presence of both ethyl and triethoxysilyl functional groups attached to a benzoate structure. This compound typically appears as a colorless to pale yellow liquid and is known for its reactivity, particularly in forming siloxane bonds, which makes it useful in various applications such as surface modification, adhesion promotion, and as a coupling agent in composite materials. The triethoxysilyl group enhances its ability to bond with inorganic substrates, while the ethyl group contributes to its solubility in organic solvents. Ethyl-4-(triethoxysilyl)benzoate is often utilized in the formulation of coatings, sealants, and adhesives, where it can improve durability and resistance to environmental factors. Additionally, its chemical structure allows for potential applications in the development of hybrid organic-inorganic materials, making it a valuable compound in materials science and engineering. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C15H24O5Si
InChI:InChI=1/C15H24O5Si/c1-5-17-15(16)13-9-11-14(12-10-13)21(18-6-2,19-7-3)20-8-4/h9-12H,5-8H2,1-4H3
SMILES:CCOC(=O)c1ccc(cc1)[Si](OCC)(OCC)OCC
Synonyms:
  • ethyl 4-(triethoxysilyl)benzoate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.