CAS 19768-89-9
:9-(beta-D-arabinofuranosyl)-9H-purine-2,6-diamine
Description:
9-(β-D-arabinofuranosyl)-9H-purine-2,6-diamine, commonly known as Ara-A or arabinosyladenine, is a nucleoside analog with notable antiviral properties. It is characterized by its purine base structure, specifically adenine, linked to a β-D-arabinofuranosyl sugar moiety. This compound exhibits a unique configuration that enhances its ability to inhibit viral replication, making it particularly effective against certain viruses, including those responsible for herpes simplex and other viral infections. The presence of amino groups at the 2 and 6 positions of the purine ring contributes to its biological activity. Ara-A is typically administered in a phosphorylated form, which is crucial for its incorporation into viral DNA, thereby disrupting the viral life cycle. Its pharmacological profile includes potential side effects, which necessitate careful monitoring during therapeutic use. Overall, Ara-A serves as an important compound in antiviral research and treatment, showcasing the significance of nucleoside analogs in modern medicine.
Formula:C10H14N6O4
InChI:InChI=1/C10H14N6O4/c11-7-4-8(15-10(12)14-7)16(2-13-4)9-6(19)5(18)3(1-17)20-9/h2-3,5-6,9,17-19H,1H2,(H4,11,12,14,15)/t3-,5-,6+,9-/m1/s1
Synonyms:- 2,6-Diaminopurine-9-arabinoside
- 2,6-diamino purine arabinoside
- 9H-Purine-2,6-diamine, 9-beta-D-arabinofuranosyl-
- 9-(β-D-arabinofuranosyl)-2,6-Diamino-purine
- Aids000249
- 9H-Purine-2,6-diamine, 9-B-D-xylofuranosyl-
- Aids-000249
- Aradapr
- 9-.beta.-D-Arabinofuranosyl-2,6-diaminopurine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
