CAS 1977-09-9
:11-(4-methylpiperazin-1-yl)dibenzo[b,f][1,4]thiazepine
Description:
11-(4-Methylpiperazin-1-yl)dibenzo[b,f][1,4]thiazepine is a chemical compound characterized by its complex structure, which includes a dibenzo[b,f][1,4]thiazepine core fused with a 4-methylpiperazine moiety. This compound typically exhibits properties associated with heterocyclic compounds, including potential pharmacological activity. The thiazepine ring contributes to its stability and reactivity, while the piperazine substituent may enhance its solubility and interaction with biological targets. The presence of nitrogen and sulfur atoms in its structure suggests potential for diverse chemical reactivity and biological activity, making it of interest in medicinal chemistry. It may be investigated for its effects on neurotransmitter systems, given the piperazine component, which is often associated with psychoactive properties. As with many organic compounds, its physical properties such as melting point, boiling point, and solubility can vary based on environmental conditions and the presence of solvents. Overall, this compound represents a unique scaffold that could be explored for therapeutic applications.
Formula:C18H19N3S
InChI:InChI=1/C18H19N3S/c1-20-10-12-21(13-11-20)18-14-6-2-4-8-16(14)22-17-9-5-3-7-15(17)19-18/h2-9H,10-13H2,1H3
SMILES:CN1CCN(CC1)C1=Nc2ccccc2Sc2ccccc12
Synonyms:- Dibenzo[B,F][1,4]Thiazepine, 11-(4-Methyl-1-Piperazinyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Quetiapine Impurity 8
CAS:Formula:C18H19N3SColor and Shape:White To Off-White SolidMolecular weight:309.4311-(4-Methyl-1-piperazinyl)dibenzo[b,f][1,4]thiazepine
CAS:Formula:C18H19N3SColor and Shape:NeatMolecular weight:309.4286Quetiapine Impurity 8
CAS:<p>Quetiapine Impurity 8 is a drug product that is used as an analytical standard for drug metabolism studies. It is a natural impurity found in the API Quetiapine, which has the CAS number 1977-09-9. Quetiapine Impurity 8 is also an impurity standard for HPLC and has been shown to be a synthetic compound. This compound can be custom synthesized and is often used in research and development of new drugs. Quetiapine Impurity 8 has high purity and pharmacopoeia grade, making it suitable for use in niche markets such as drug development, research, and analysis.</p>Formula:C18H19N3SPurity:Min. 95%Molecular weight:309.4 g/mol




