CAS 19774-97-1

(4-chloro-2-cyclohexylphenoxy)acetic acid

Description:

(4-Chloro-2-cyclohexylphenoxy)acetic acid, with the CAS number 19774-97-1, is an organic compound that belongs to the class of phenoxyacetic acids. This substance features a phenoxy group, which is a phenyl ring bonded to an ether oxygen, and is substituted with a chlorine atom at the para position and a cyclohexyl group at the ortho position relative to the ether linkage. The presence of the carboxylic acid functional group (-COOH) contributes to its acidic properties. This compound is typically characterized by its moderate solubility in organic solvents and limited solubility in water, which is common for many phenoxy compounds. It may exhibit biological activity, particularly in agricultural applications, as it can function as a herbicide or plant growth regulator. The structural features of (4-chloro-2-cyclohexylphenoxy)acetic acid suggest potential interactions with plant hormone pathways, influencing growth and development. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity and environmental impact.

Formula: C₁₄H₁₇ClO₃

InChI: InChI=1/C14H17ClO3/c15-11-6-7-13(18-9-14(16)17)12(8-11)10-4-2-1-3-5-10/h6-8,10H,1-5,9H2,(H,16,17)

SMILES: C1CCC(CC1)c1cc(ccc1OCC(=O)O)Cl

Synonyms:

• Acetic Acid, 2-(4-Chloro-2-Cyclohexylphenoxy)-

(4-Chloro-2-cyclohexylphenoxy)acetic acid

CAS: 19774-97-1

(4-Chloro-2-cyclohexylphenoxy)acetic acid

Purity: ≥95%

Molecular weight: 268.74g/mol

Ref: 54-OR111586