CAS 197775-45-4
:5-PYRIDIN-4-YL-4H-PYRAZOLE-3-CARBOXYLIC ACID
Description:
5-Pyridin-4-yl-4H-pyrazole-3-carboxylic acid is a heterocyclic organic compound characterized by its pyrazole and pyridine moieties. This compound features a carboxylic acid functional group, which contributes to its acidity and potential reactivity. The presence of the pyridine ring imparts unique electronic properties, making it a candidate for various chemical reactions and applications in medicinal chemistry. It is often studied for its biological activity, particularly in the development of pharmaceuticals, as compounds with similar structures have shown promise in targeting specific biological pathways. The compound is typically solid at room temperature and may exhibit moderate solubility in polar solvents due to the carboxylic acid group. Its molecular structure allows for potential interactions with biological targets, making it of interest in drug design and development. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings.
Formula:C9H7N3O2
InChI:InChI=1/C9H7N3O2/c13-9(14)8-5-7(11-12-8)6-1-3-10-4-2-6/h1-5H,(H,11,12)(H,13,14)
SMILES:c1cnccc1c1cc(C(=O)O)n[nH]1
Synonyms:- Timtec-Bb Sbb010785
- Akos Pao-0368
- 5-(Pyrid-4-Yl)-3-Pyrazolecarboxylic Acid
- 5-(Pyrid-4-Yl)Pyrazole-3-Carboxylic Acid
- 5-Pyridin-4-Yl-1H-Pyrazole-3-Carboxylic Acid
- 3-pyridin-4-yl-1H-pyrazole-5-carboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1H-Pyrazole-3-carboxylic acid, 5-(4-pyridinyl)-
CAS:Formula:C9H7N3O2Purity:95%Color and Shape:SolidMolecular weight:189.17085-(Pyrid-4-yl)pyrazole-3-carboxylic acid
CAS:<p>5-(Pyrid-4-yl)pyrazole-3-carboxylic acid</p>Purity:97%Molecular weight:189.17g/mol5-Pyridin-4-yl-1H-pyrazole-3-carboxylic acid
CAS:<p>5-Pyridin-4-yl-1H-pyrazole-3-carboxylic acid is a white crystalline solid. It is soluble in water, methanol and ethanol. The molecular weight of 5-Pyridin-4-yl-1H-pyrazole-3 carboxylic acid is 177.17 g/mol. This compound has been found to have an elemental composition of C, H, N and O with a calculated density of 1.62 g/cm3 in the form of a single crystal x ray diffraction pattern. 5-Pyridin 4 yl 1H pyrazole 3 carboxylic acid has synergistic effects with other drugs used for chemotherapy such as cisplatin and doxorubicin against cancer cells.</p>Formula:C9H7N3O2Purity:Min. 95%Color and Shape:PowderMolecular weight:189.17 g/mol5-(Pyrid-4-yl)-3-pyrazolecarboxylic acid
CAS:Formula:C9H7N3O2Purity:97.0%Color and Shape:SolidMolecular weight:189.174



