CymitQuimica logo

CAS 19786-56-2

:

4-HYDRAZINO-5-METHYLTHIENO[2,3-D]PYRIMIDINE

Description:
4-Hydrazino-5-methylthieno[2,3-d]pyrimidine is a heterocyclic compound characterized by its unique thieno-pyrimidine structure, which incorporates both sulfur and nitrogen atoms in its ring system. This compound features a hydrazino group (-NH-NH2) at the 4-position and a methylthio group (-S-CH3) at the 5-position, contributing to its reactivity and potential biological activity. The presence of the hydrazino group suggests that it may participate in various chemical reactions, including those involving hydrazone formation or redox processes. Additionally, the thieno-pyrimidine framework is known for its relevance in medicinal chemistry, often exhibiting pharmacological properties such as antimicrobial or antitumor activities. The compound's solubility, stability, and reactivity can be influenced by the functional groups attached to the thieno-pyrimidine core. Overall, 4-hydrazino-5-methylthieno[2,3-d]pyrimidine represents a class of compounds that may have significant implications in drug development and synthetic chemistry.
Formula:C7H8N4S
InChI:InChI=1/C7H8N4S/c1-4-2-12-7-5(4)6(11-8)9-3-10-7/h2-3H,8H2,1H3,(H,9,10,11)
SMILES:Cc1csc2c1c(ncn2)NN
Synonyms:
  • 5-Methylthieno[2,3-D]Pyrimidin-4-Hydrazine
  • Buttpark 46\19-76
  • 4-Hydrazino-5-methylthieno[2,3-d]pyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.