CAS 197960-31-9

2-cyano-5-methylbenzenesulfonyl chloride

Description:

2-Cyano-5-methylbenzenesulfonyl chloride is an organic compound characterized by the presence of a sulfonyl chloride functional group attached to a benzene ring that also features a cyano and a methyl substituent. This compound typically appears as a solid or liquid, depending on its purity and specific conditions. It is known for its reactivity, particularly due to the sulfonyl chloride group, which can participate in nucleophilic substitution reactions. The cyano group contributes to its polarity and can influence its solubility in various solvents. This compound is often utilized in organic synthesis, particularly in the preparation of sulfonamide derivatives and other complex molecules. Safety precautions are essential when handling this substance, as it can be corrosive and may release toxic gases upon reaction with water or moisture. Proper storage in a cool, dry place, away from incompatible materials, is also recommended to maintain its stability and integrity.

Formula: C₈H₆ClNO₂S

InChI: InChI=1/C8H6ClNO2S/c1-6-2-3-7(5-10)8(4-6)13(9,11)12/h2-4H,1H3

SMILES: Cc1ccc(C#N)c(c1)S(=O)(=O)Cl

Benzenesulfonylchloride, 2-cyano-5-methyl-

CAS: 197960-31-9

Formula: C₈H₆ClNO₂S

Purity: 98%

Color and Shape: Solid

Molecular weight: 215.6567

Ref: IN-DA002B7F

2-Cyano-5-methylbenzenesulphonyl chloride

CAS: 197960-31-9

2-Cyano-5-methylbenzenesulphonyl chloride

Formula: C₈H₆ClNO₂S

Purity: 98%

Color and Shape: pale yellow crystalline powder

Molecular weight: 215.66g/mol

Ref: 54-OR25992

2-Cyano-5-methylbenzenesulfonyl chloride

CAS: 197960-31-9

Purity: 98%

Molecular weight: 215.6499939

Ref: 10-F771901

2-Cyano-5-methylbenzenesulfonyl chloride

CAS: 197960-31-9

Versatile small molecule scaffold

Formula: C₈H₆ClNO₂S

Purity: Min. 95%

Molecular weight: 215.66 g/mol

Ref: 3D-XHA96031