CAS 1980076-31-0

(OC-6-21)-[3-Bromo-4-(bromomethyl)phenyl]pentafluorosulfur

Description:

(OC-6-21)-[3-Bromo-4-(bromomethyl)phenyl]pentafluorosulfur is a specialized chemical compound characterized by its unique structure, which includes a phenyl ring substituted with bromine and bromomethyl groups, as well as a pentafluorosulfur moiety. The presence of multiple bromine atoms suggests that this compound may exhibit significant reactivity and potential applications in organic synthesis or materials science. The pentafluorosulfur group indicates a high degree of fluorination, which can impart unique electronic and physical properties, such as increased stability and altered solubility. This compound may be of interest in fields such as medicinal chemistry, where halogenated compounds are often explored for their biological activity. Additionally, the specific arrangement of substituents can influence the compound's reactivity and interactions with other chemical species. As with many halogenated compounds, safety precautions should be taken due to potential toxicity and environmental concerns associated with brominated and fluorinated substances.

Formula: C₇H₅Br₂F₅S

InChI: InChI=1S/C7H5Br2F5S/c8-4-5-1-2-6(3-7(5)9)15(10,11,12,13)14/h1-3H,4H2

InChI key: InChIKey=SZTODRUTIZVHTK-UHFFFAOYSA-N

SMILES: S(F)(F)(F)(F)(F)C1=CC(Br)=C(CBr)C=C1

Synonyms:

• (OC-6-21)-[3-Bromo-4-(bromomethyl)phenyl]pentafluorosulfur
• Sulfur, [3-bromo-4-(bromomethyl)phenyl]pentafluoro-, (OC-6-21)-

2-Bromo-4-(pentafluorothio)benzyl bromide

CAS: 1980076-31-0

2-Bromo-4-(pentafluorothio)benzyl bromide

Purity: ≥95%

Molecular weight: 375.97961g/mol

Ref: 54-PC501343