CAS 19810-31-2
:2-(Benzyloxy)acetyl chloride
Description:
2-(Benzyloxy)acetyl chloride, with the CAS number 19810-31-2, is an organic compound characterized by the presence of both an acetyl chloride functional group and a benzyloxy substituent. This compound typically appears as a colorless to pale yellow liquid and is known for its reactivity, particularly in acylation reactions. The acetyl chloride moiety makes it a potent acylating agent, allowing it to react with various nucleophiles, including alcohols and amines, to form esters and amides, respectively. The benzyloxy group enhances the compound's stability and solubility in organic solvents, making it useful in synthetic organic chemistry. Additionally, 2-(Benzyloxy)acetyl chloride can be sensitive to moisture, as it can hydrolyze to form the corresponding carboxylic acid and benzyl alcohol. Safety precautions are essential when handling this compound due to its corrosive nature and potential to release hydrochloric acid upon reaction. Overall, its unique structure and reactivity profile make it a valuable intermediate in the synthesis of various organic compounds.
Formula:C9H9ClO2
InChI:InChI=1/C9H9ClO2/c10-9(11)7-12-6-8-4-2-1-3-5-8/h1-5H,6-7H2
SMILES:c1ccc(cc1)COCC(=O)Cl
Synonyms:- Benzyloxyacetyl chloride
- Benzyl Carbonochloridate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Benzyloxyacetyl chloride, 95%
CAS:Benzyloxyacetyl chloride is a reagent used to construct substituted 2-azetidinones for further elaboration into annulated -lactams. It is a commonly employed reagent for asymmetric synthesis of -lactams. It is also used in preparation of (S)-3-(methylamino)-3-((R)-pyrrolidin-3-yl)propanenitrile, key
Formula:C9H9ClO2Purity:95%Color and Shape:liquid, Clear, colourless to pale yellowMolecular weight:184.62Acetyl chloride, 2-(phenylmethoxy)-
CAS:Formula:C9H9ClO2Purity:95%Color and Shape:LiquidMolecular weight:184.6196Benzyloxyacetyl chloride
CAS:Benzyloxyacetyl chloridePurity:95%Color and Shape:LiquidMolecular weight:184.62g/mol2-(Benzyloxy)acetyl Chloride
CAS:Formula:C9H9ClO2Purity:>98.0%(GC)(T)Color and Shape:White to Yellow to Yellow green clear liquidMolecular weight:184.622-(Benzyloxy)acetyl chloride
CAS:Formula:C9H9ClO2Purity:98.0%Color and Shape:LiquidMolecular weight:184.62




