CymitQuimica logo

CAS 198134-75-7

:

N-(2,5-DIMETHOXYPHENYL)-4-FLUOROBENZAMIDE

Description:
N-(2,5-Dimethoxyphenyl)-4-fluorobenzamide is a chemical compound characterized by its specific functional groups and structural features. It contains a benzamide moiety, which is a derivative of benzoic acid where the hydroxyl group is replaced by an amine. The presence of a fluorine atom at the para position of the benzene ring enhances its lipophilicity and may influence its biological activity. The two methoxy groups at the 2 and 5 positions of the phenyl ring contribute to its electronic properties and steric hindrance, potentially affecting its reactivity and interaction with biological targets. This compound is of interest in medicinal chemistry and pharmacology, as modifications to the benzamide structure can lead to variations in pharmacokinetics and pharmacodynamics. Its CAS number, 198134-75-7, allows for precise identification in chemical databases and literature. Overall, the unique combination of functional groups in N-(2,5-Dimethoxyphenyl)-4-fluorobenzamide suggests potential applications in drug development and research.
Formula:C15H14FNO3
InChI:InChI=1/C15H14FNO3/c1-19-12-7-8-14(20-2)13(9-12)17-15(18)10-3-5-11(16)6-4-10/h3-9H,1-2H3,(H,17,18)
SMILES:COc1ccc(c(c1)NC(=O)c1ccc(cc1)F)OC
Synonyms:
  • benzamide, N-(2,5-dimethoxyphenyl)-4-fluoro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.