CAS 19815-16-8

4-CHLORO-6-NITROQUINAZOLINE

Description:

4-Chloro-6-nitroquinazoline is a heterocyclic organic compound characterized by a quinazoline core structure, which consists of a fused benzene and pyrimidine ring. The presence of a chlorine atom at the 4-position and a nitro group at the 6-position contributes to its unique chemical properties. This compound is typically a yellow to orange crystalline solid and is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. It exhibits moderate solubility in organic solvents and is relatively stable under standard laboratory conditions. The presence of the nitro group can influence its reactivity, making it a potential candidate for further chemical modifications. Additionally, 4-chloro-6-nitroquinazoline may exhibit biological activity, which has been the subject of research in various fields, including cancer therapy and antimicrobial studies. As with many chemical substances, proper handling and safety precautions are essential due to its potential toxicity and environmental impact.

Formula: C₈H₄ClN₃O₂

InChI: InChI=1/C8H4ClN3O2/c9-8-6-3-5(12(13)14)1-2-7(6)10-4-11-8/h1-4H

SMILES: c1cc2c(cc1N(=O)=O)c(Cl)ncn2

Synonyms:

• 4-Chlor-6-nitrochinazolin
• Quinazoline, 4-chloro-6-nitro-

Quinazoline, 4-chloro-6-nitro-

CAS: 19815-16-8

Formula: C₈H₄ClN₃O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 209.5893

Ref: IN-DA002BBQ

4-Chloro-6-nitroquinazoline

CAS: 19815-16-8

4-Chloro-6-nitroquinazoline

Purity: 95%

Molecular weight: 209.59g/mol

Ref: 54-OR90349

4-Chloro-6-nitroquinazoline

Controlled Product

CAS: 19815-16-8

Applications Intermediate in the preparation of anticancer agents and enzyme inhibitors.
References Felts, A., et al.: Bioorg. Med. Chem. Lett., 19, 6623 (2009), Murai, M., et al.: Biochem., 48, 688 (2009),

Formula: C₈H₄ClN₃O₂

Color and Shape: Neat

Molecular weight: 209.59

Ref: TR-C374785

4-Chloro-6-nitroquinazoline

CAS: 19815-16-8

Formula: C₈H₄ClN₃O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 209.59

Ref: 10-F047916