CAS 19817-70-0
:Alanine, N-benzoyl-3-phenyl-, ethyl ester, DL-
Description:
Alanine, N-benzoyl-3-phenyl-, ethyl ester, DL- is an organic compound characterized by its structure, which includes an alanine backbone modified with a benzoyl group and an ethyl ester functional group. This compound is a derivative of the amino acid alanine, featuring a phenyl group that contributes to its aromatic properties. It is typically a white to off-white solid and is soluble in organic solvents, making it useful in various chemical applications. The presence of the benzoyl and ethyl ester groups enhances its reactivity, allowing it to participate in various chemical reactions, such as esterification and amidation. This compound may be utilized in the synthesis of pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. Additionally, its DL designation indicates that it is a racemic mixture of both enantiomers, which can exhibit different biological activities. Safety data should be consulted for handling and usage, as with all chemical substances.
Formula:C18H19NO3
InChI:InChI=1/C18H19NO3/c1-2-22-18(21)16(13-14-9-5-3-6-10-14)19-17(20)15-11-7-4-8-12-15/h3-12,16H,2,13H2,1H3,(H,19,20)/t16-/m0/s1
SMILES:CCOC(=O)[C@H](Cc1ccccc1)N=C(c1ccccc1)O
Synonyms:- N-Benzoyl-3-phenyl-DL-alanine ethyl ester
- ethyl N-benzoyl-L-phenylalaninate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.